Tricyclo[4.3.1.1(3,8)]undecane-1-carboxylic acid
Modify Date: 2025-09-12 14:27:32
![Tricyclo[4.3.1.1(3,8)]undecane-1-carboxylic acid Structure](https://image.chemsrc.com/caspic/479/31061-65-1.png)
Tricyclo[4.3.1.1(3,8)]undecane-1-carboxylic acid structure
|
Common Name | Tricyclo[4.3.1.1(3,8)]undecane-1-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 31061-65-1 | Molecular Weight | 194.27000 | |
| Density | 1.183g/cm3 | Boiling Point | 321.4ºC at 760 mmHg | |
| Molecular Formula | C12H18O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 150.7ºC | |
| Name | Tricyclo[4.3.1.1(3,8)]undecane-1-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.183g/cm3 |
|---|---|
| Boiling Point | 321.4ºC at 760 mmHg |
| Molecular Formula | C12H18O2 |
| Molecular Weight | 194.27000 |
| Flash Point | 150.7ºC |
| Exact Mass | 194.13100 |
| PSA | 37.30000 |
| LogP | 2.67750 |
| Index of Refraction | 1.556 |
| InChIKey | STNYGMDZVYBFLR-UHFFFAOYSA-N |
| SMILES | O=C(O)C12CC3CCC(CC(C3)C1)C2 |
| HS Code | 2916209090 |
|---|
| HS Code | 2916209090 |
|---|---|
| Summary | 2916209090 other cyclanic, cyclenic or cyclotherpenic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| Homoadamantane-1-carboxylic acid |
| tricyclo[4.3.1.1~3,8~]undecane-1-carboxylic acid |
| 1-Homoadamantanecarboxylic acid |
| 1-Homoadamantylcarbonsaeure |
| Homoadamantan-1-carboxylic Acid |
| Tricyclo[4.3.1.13,8]undecan-1-carbonsaeure |
| Homoadamantan-1-carbonsaeure |