Cedeodarin structure
|
Common Name | Cedeodarin | ||
|---|---|---|---|---|
| CAS Number | 31076-39-8 | Molecular Weight | 318.28 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 692.9±55.0 °C at 760 mmHg | |
| Molecular Formula | C16H14O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 262.6±25.0 °C | |
Use of CedeodarinCedeodarin is a taxifolin that can be isolated from Cedms deodara[1]. |
| Name | 6-methoxytaxifolin |
|---|---|
| Synonym | More Synonyms |
| Description | Cedeodarin is a taxifolin that can be isolated from Cedms deodara[1]. |
|---|---|
| Related Catalog | |
| References |
[1]. Agrawal, P. K., et al. Dihydroflavonols from Cedrus deodara. Phytochemistry, 19(5), 893–896. |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 692.9±55.0 °C at 760 mmHg |
| Molecular Formula | C16H14O7 |
| Molecular Weight | 318.28 |
| Flash Point | 262.6±25.0 °C |
| Exact Mass | 318.073944 |
| PSA | 127.45000 |
| LogP | 2.28 |
| Vapour Pressure | 0.0±2.3 mmHg at 25°C |
| Index of Refraction | 1.739 |
| InChIKey | KPCWWZLBHGSXPW-JKSUJKDBSA-N |
| SMILES | Cc1c(O)cc2c(c1O)C(=O)C(O)C(c1ccc(O)c(O)c1)O2 |
| Hazard Codes | Xi |
|---|
| Cedeodarin |
| 4H-1-Benzopyran-4-one, 2-(3,4-dihydroxyphenyl)-2,3-dihydro-3,5,7-trihydroxy-6-methyl-, (2R,3R)- |
| (2R,3R)-2-(3,4-Dihydroxyphenyl)-3,5,7-trihydroxy-6-methyl-2,3-dihydro-4H-chromen-4-one |