5-chlorooctafluoropentanoyl chloride structure
|
Common Name | 5-chlorooctafluoropentanoyl chloride | ||
|---|---|---|---|---|
| CAS Number | 3110-03-0 | Molecular Weight | 298.94600 | |
| Density | 1.71g/cm3 | Boiling Point | 100ºC at 760mmHg | |
| Molecular Formula | C5Cl2F8O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 14.3ºC | |
| Name | 5-chlorooctafluoropentanoyl chloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.71g/cm3 |
|---|---|
| Boiling Point | 100ºC at 760mmHg |
| Molecular Formula | C5Cl2F8O |
| Molecular Weight | 298.94600 |
| Flash Point | 14.3ºC |
| Exact Mass | 297.92000 |
| PSA | 17.07000 |
| LogP | 3.48930 |
| Index of Refraction | 1.334 |
| InChIKey | FUWJMSXDKGZFFT-UHFFFAOYSA-N |
| SMILES | O=C(Cl)C(F)(F)C(F)(F)C(F)(F)C(F)(F)Cl |
| Hazard Codes | C: Corrosive; |
|---|---|
| Risk Phrases | 34 |
| Safety Phrases | 26-36/37/39 |
| RIDADR | UN 3265 |
| HS Code | 2915900090 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2915900090 |
|---|---|
| Summary | 2915900090 other saturated acyclic monocarboxylic acids and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:5.5% General tariff:30.0% |
| pentanoyl chloride,5-chloro-2,2,3,3,4,4,5,5-octafluoro |
| 5-CHLOROPERFLUOROPENTANOYL CHLORIDE |
| 5-CHLOROPERFLUOROPENTANOIC ACID |
| 5-Chlor-perfluor-pentansaeure-chlorid |
| 5-chloro-2,2,3,3,4,4,5,5-octafluoropentanoyl chloride |
| MFCD00155685 |