1-(2,4,6-TRICHLOROPHENYL)-2-THIOUREA structure
|
Common Name | 1-(2,4,6-TRICHLOROPHENYL)-2-THIOUREA | ||
|---|---|---|---|---|
| CAS Number | 31118-87-3 | Molecular Weight | 255.55200 | |
| Density | 1.665 g/cm3 | Boiling Point | 342.7ºC at 760 mmHg | |
| Molecular Formula | C7H5Cl3N2S | Melting Point | 206-211 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 161.1ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | (2,4,6-trichlorophenyl)thiourea |
|---|---|
| Synonym | More Synonyms |
| Density | 1.665 g/cm3 |
|---|---|
| Boiling Point | 342.7ºC at 760 mmHg |
| Melting Point | 206-211 °C(lit.) |
| Molecular Formula | C7H5Cl3N2S |
| Molecular Weight | 255.55200 |
| Flash Point | 161.1ºC |
| Exact Mass | 253.92400 |
| PSA | 70.14000 |
| LogP | 4.07560 |
| Index of Refraction | 1.732 |
| InChIKey | ZUSZPZPGZMEXLA-UHFFFAOYSA-N |
| SMILES | NC(=S)Nc1c(Cl)cc(Cl)cc1Cl |
| Storage condition | 2-8 °C |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H317 |
| Precautionary Statements | P280 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Faceshields;Gloves |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | R43 |
| Safety Phrases | S36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| Packaging Group | III |
| HS Code | 2930909090 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2930909090 |
|---|---|
| Summary | 2930909090. other organo-sulphur compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| N-2,4,6-Trichlorphenylschwefelharnstoff |
| 2,4,6-trichlorophenylthiourea |
| MFCD00041153 |
| N-(2,4,6-Trichlorophenyl)thiourea |