2,6-ditert-butyl-4-[(3,5-ditert-butyl-4-hydroxyphenyl)tetrasulfanyl]phenol structure
|
Common Name | 2,6-ditert-butyl-4-[(3,5-ditert-butyl-4-hydroxyphenyl)tetrasulfanyl]phenol | ||
|---|---|---|---|---|
| CAS Number | 31121-17-2 | Molecular Weight | 538.89200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C28H42O2S4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,6-ditert-butyl-4-[(3,5-ditert-butyl-4-hydroxyphenyl)tetrasulfanyl]phenol |
|---|
| Molecular Formula | C28H42O2S4 |
|---|---|
| Molecular Weight | 538.89200 |
| Exact Mass | 538.20700 |
| PSA | 141.66000 |
| LogP | 10.38360 |
| InChIKey | NTBBKEPYDZYMOW-UHFFFAOYSA-N |
| SMILES | CC(C)(C)c1cc(SSSSc2cc(C(C)(C)C)c(O)c(C(C)(C)C)c2)cc(C(C)(C)C)c1O |
|
~90%
2,6-ditert-buty... CAS#:31121-17-2 |
| Literature: Farzaliev; Allakhverdiev; Sattar-zade; Rzaeva Russian Journal of Applied Chemistry, 2001 , vol. 74, # 12 p. 2083 - 2086 |
|
~%
2,6-ditert-buty... CAS#:31121-17-2 |
| Literature: Farzaliev; Allakhverdiev; Sattar-zade; Rzaeva Russian Journal of Applied Chemistry, 2001 , vol. 74, # 12 p. 2083 - 2086 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |