2,6-di-tert-butyl-4-sulfanylphenol structure
|
Common Name | 2,6-di-tert-butyl-4-sulfanylphenol | ||
|---|---|---|---|---|
| CAS Number | 950-59-4 | Molecular Weight | 238.389 | |
| Density | 1.0±0.1 g/cm3 | Boiling Point | 302.3±42.0 °C at 760 mmHg | |
| Molecular Formula | C14H22OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 136.6±27.9 °C | |
| Name | 2,6-ditert-butyl-4-sulfanylphenol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 302.3±42.0 °C at 760 mmHg |
| Molecular Formula | C14H22OS |
| Molecular Weight | 238.389 |
| Flash Point | 136.6±27.9 °C |
| Exact Mass | 238.139130 |
| PSA | 59.03000 |
| LogP | 5.06 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.537 |
| InChIKey | NFVMNXZFSKGLDR-UHFFFAOYSA-N |
| SMILES | CC(C)(C)c1cc(S)cc(C(C)(C)C)c1O |
| Safety Phrases | S22-S26-S36/37/39 |
|---|---|
| HS Code | 2930909090 |
|
~81%
2,6-di-tert-but... CAS#:950-59-4 |
| Literature: Pastor, Stephen D.; Odorisio, Paul A.; Ravichandran, Ramanathan Phosphorus and Sulfur and the Related Elements, 1987 , vol. 29, p. 67 - 72 |
|
~%
2,6-di-tert-but... CAS#:950-59-4 |
| Literature: Justus Liebigs Annalen der Chemie, , vol. 645, p. 79 - 91 |
|
~70%
2,6-di-tert-but... CAS#:950-59-4 |
| Literature: Tanaka, Hideo; Tokumaru, Yoshihisa; Fukui, Ken-Ichi; Kuroboshi, Manabu; Torii, Sigeru; Jutand, Anny; Amatore, Christian Synthesis, 2009 , # 20 p. 3449 - 3459 |
| Precursor 3 | |
|---|---|
| DownStream 10 | |
| HS Code | 2930909090 |
|---|---|
| Summary | 2930909090. other organo-sulphur compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|
Name: Cell survival assay for modulators of telomere damage signalling
Source: 15378
Target: N/A
External Id: TELO_02
|
|
Name: Alphascreen assay for small molecules abrogating mHTT-CaM Interaction
Source: 24983
Target: Huntingtin
External Id: KUHTS-Muma KU-CaM-Htt INH-01
|
| 2,6-bis(tert-butyl)-4-sulfanylphenol |
| EINECS 213-451-5 |
| 3,5-di-tert-butyl-4-hydroxyphenylthiol |
| 3,5-di-t-butyl-4-hydroxyphenylmercaptane |
| 4-hydroxy-3,5-di-tert-butylphenylthiol |
| 3,5-di-tert-butyl-4-hydroxybenzenethiol |
| 4-hydroxy-3,5-di-t-butylbenzenethiol |
| 2,6-Di-tert-butyl-4-mercaptophenol |
| 2,6-di-tert-butyl-4-sulfanylphenol |
| 2,6-bis(1,1-dimethylethyl)-4-mercaptophenol |
| 2,6-Di-tert-butyl-4-thiophenol |
| 2,6-Bis(2-methyl-2-propanyl)-4-sulfanylphenol |
| 3,5-di-tert-butyl-4hydroxythiophenol |