Benzene,1-[(5-bromopentyl)oxy]-2-chloro-4-nitro- structure
|
Common Name | Benzene,1-[(5-bromopentyl)oxy]-2-chloro-4-nitro- | ||
|---|---|---|---|---|
| CAS Number | 31191-38-5 | Molecular Weight | 322.58300 | |
| Density | 1.49g/cm3 | Boiling Point | 415.8ºC at 760 mmHg | |
| Molecular Formula | C11H13BrClNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 205.3ºC | |
| Name | 1-(5-bromopentoxy)-2-chloro-4-nitrobenzene |
|---|
| Density | 1.49g/cm3 |
|---|---|
| Boiling Point | 415.8ºC at 760 mmHg |
| Molecular Formula | C11H13BrClNO3 |
| Molecular Weight | 322.58300 |
| Flash Point | 205.3ºC |
| Exact Mass | 320.97700 |
| PSA | 55.05000 |
| LogP | 4.71540 |
| Index of Refraction | 1.566 |
| InChIKey | OUVBPGPEOSRBQQ-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(OCCCCCBr)c(Cl)c1 |
|
~%
Benzene,1-[(5-b... CAS#:31191-38-5 |
| Literature: Baker,B.R.; Ashton,W.T. Journal of Medicinal Chemistry, 1970 , vol. 13, # 6 p. 1149 - 1154 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |