Pifoxime structure
|
Common Name | Pifoxime | ||
|---|---|---|---|---|
| CAS Number | 31224-92-7 | Molecular Weight | 276.33100 | |
| Density | 1.18g/cm3 | Boiling Point | 494.7ºC at 760mmHg | |
| Molecular Formula | C15H20N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 253ºC | |
Use of PifoximePifoxime is a COX-1/2 inhibitor, a non-steroidal anti-inflammatory agent (NSAID). Pifoxime shows anti-inflammatory activity, and can be used in neuropsychiatric research[1][2]. |
| Name | 2-[4-[(E)-N-hydroxy-C-methylcarbonimidoyl]phenoxy]-1-piperidin-1-ylethanone |
|---|---|
| Synonym | More Synonyms |
| Description | Pifoxime is a COX-1/2 inhibitor, a non-steroidal anti-inflammatory agent (NSAID). Pifoxime shows anti-inflammatory activity, and can be used in neuropsychiatric research[1][2]. |
|---|---|
| Related Catalog | |
| Target |
COX-1 COX-2 |
| Density | 1.18g/cm3 |
|---|---|
| Boiling Point | 494.7ºC at 760mmHg |
| Molecular Formula | C15H20N2O3 |
| Molecular Weight | 276.33100 |
| Flash Point | 253ºC |
| Exact Mass | 276.14700 |
| PSA | 62.13000 |
| LogP | 2.21400 |
| Index of Refraction | 1.571 |
| InChIKey | XUDSQIDNHJMBBW-UHFFFAOYSA-N |
| SMILES | CC(=NO)c1ccc(OCC(=O)N2CCCCC2)cc1 |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Pixifenide |
| Pifoxima [INN-Spanish] |
| 1-((p-Acetylphenoxy)acetyl)piperidine p-oxime |
| Pifoximum [INN-Latin] |
| 1-<p-(1-Oximinoaethyl)phenoxyacetyl>piperidin |
| 1-{[4-(1-hydroxyimino-ethyl)-phenoxy]-acetyl}-piperidine |
| Pifoxime |
| Flamanil |
| SW 77 |
| 1-(p-(1-Oximidoethyl)phenoxyacetyl)piperidine |