5-bromo-N-(2-fluorophenyl)-2-furamide structure
|
Common Name | 5-bromo-N-(2-fluorophenyl)-2-furamide | ||
|---|---|---|---|---|
| CAS Number | 312704-38-4 | Molecular Weight | 284.08100 | |
| Density | 1.656g/cm3 | Boiling Point | 265.3ºC at 760 mmHg | |
| Molecular Formula | C11H7BrFNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 114.2ºC | |
| Name | 5-bromo-N-(2-fluorophenyl)furan-2-carboxamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.656g/cm3 |
|---|---|
| Boiling Point | 265.3ºC at 760 mmHg |
| Molecular Formula | C11H7BrFNO2 |
| Molecular Weight | 284.08100 |
| Flash Point | 114.2ºC |
| Exact Mass | 282.96400 |
| PSA | 42.24000 |
| LogP | 3.50650 |
| Index of Refraction | 1.627 |
| InChIKey | QYEVHULUBYKZBF-UHFFFAOYSA-N |
| SMILES | O=C(Nc1ccccc1F)c1ccc(Br)o1 |
| HS Code | 2932190090 |
|---|
| HS Code | 2932190090 |
|---|---|
| Summary | 2932190090 other compounds containing an unfused furan ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| 5-bromo-N-(2-fluorophenyl)-2-furamide |