5-bromo-N-(2-isopropylphenyl)-2-furamide
Modify Date: 2025-09-26 14:37:20
5-bromo-N-(2-isopropylphenyl)-2-furamide structure
|
Common Name | 5-bromo-N-(2-isopropylphenyl)-2-furamide | ||
|---|---|---|---|---|
| CAS Number | 314055-67-9 | Molecular Weight | 308.17000 | |
| Density | 1.417g/cm3 | Boiling Point | 310.2ºC at 760 mmHg | |
| Molecular Formula | C14H14BrNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 141.4ºC | |
| Name | 5-bromo-N-(2-propan-2-ylphenyl)furan-2-carboxamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.417g/cm3 |
|---|---|
| Boiling Point | 310.2ºC at 760 mmHg |
| Molecular Formula | C14H14BrNO2 |
| Molecular Weight | 308.17000 |
| Flash Point | 141.4ºC |
| Exact Mass | 307.02100 |
| PSA | 42.24000 |
| LogP | 4.49080 |
| Index of Refraction | 1.606 |
| InChIKey | QDDAZUOOEGOEBU-UHFFFAOYSA-N |
| SMILES | CC(C)c1ccccc1NC(=O)c1ccc(Br)o1 |
| HS Code | 2932190090 |
|---|
| HS Code | 2932190090 |
|---|---|
| Summary | 2932190090 other compounds containing an unfused furan ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| 5-bromo-N-(2-isopropylphenyl)-2-furamide |
| 5-bromo-N-[2-(propan-2-yl)phenyl]furan-2-carboxamide |