Hygromycin B structure
|
Common Name | Hygromycin B | ||
|---|---|---|---|---|
| CAS Number | 31282-04-9 | Molecular Weight | 527.520 | |
| Density | 1.7±0.1 g/cm3 | Boiling Point | 897.6±65.0 °C at 760 mmHg | |
| Molecular Formula | C20H37N3O13 | Melting Point | 160-180ºC | |
| MSDS | Chinese USA | Flash Point | 496.7±34.3 °C | |
| Symbol |
GHS05, GHS06, GHS08 |
Signal Word | Danger | |
Use of Hygromycin BHygromycin B is an aminoglycoside antibiotic active against prokaryotic and eukaryotic cells. |
| Name | Hygromycin B |
|---|---|
| Synonym | More Synonyms |
| Description | Hygromycin B is an aminoglycoside antibiotic active against prokaryotic and eukaryotic cells. |
|---|---|
| Related Catalog | |
| Target |
Target:Antibacterial; Antifungal[1] |
| In Vitro | Hygromycin B, an aminocyclitol antibiotic that strongly inhibits both 70S and 80S ribosomes, is synthesized by Streptomyces hygroscopicus[1]. Hygromycin B at 0.38 mM concentration completely halts yeast cell growth in rich media, presumably by preventing protein synthesis by cytoplasmic ribosomes. Polypeptide synthesis in cell-free extracts from rabbit reticulocytes, wheat germ and yeast is strongly blocked by low concentrations ofhygromycin B. The antibiotic inhibits peptide chain elongation by yeast polysomes by preventing elongation factor EF-2-dependent translocation. The inhibition of translocation by hygromycin B might result from the stabilization of peptidyl-tRNA bound to the ribosomal acceptor site[2]. |
| In Vivo | Hygromycin B inhibits protein synthesis by blocking ribosomal translocation without causing significant misreading in vivo[3]. Constitutive expression of the bacterial hygR gene in transgenic mice in vivo confers resistance to hygromycin B[4]. |
| Animal Admin | Hygromycin B is dissolved in sterile water. The mice C57BL/6J-TgN(pPWL512hyg)1Ems carrying hygR are treated with a single dose of hygromycin B i.p. at doses that starts at 2.7 mg/kg and increases by 50% for each consecutive dose. Control wild-type C57BL/6J mice are treated with the same volume of sterile saline. Total volume injected is 0.5 mL. The health status and body weights of animals are monitored daily for 10 consecutive days[4]. |
| Density | 1.7±0.1 g/cm3 |
|---|---|
| Boiling Point | 897.6±65.0 °C at 760 mmHg |
| Melting Point | 160-180ºC |
| Molecular Formula | C20H37N3O13 |
| Molecular Weight | 527.520 |
| Flash Point | 496.7±34.3 °C |
| Exact Mass | 527.232666 |
| PSA | 272.06000 |
| LogP | 0.64 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.672 |
| InChIKey | GRRNUXAQVGOGFE-UHFFFAOYSA-N |
| SMILES | CNC1CC(N)C(O)C(OC2OC(CO)C(O)C3OC4(OC(C(N)CO)C(O)C(O)C4O)OC23)C1O |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
MUTATION DATA
|
| Symbol |
GHS05, GHS06, GHS08 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H301 + H311-H318-H330-H334 |
| Precautionary Statements | P260-P280-P284-P301 + P310-P305 + P351 + P338-P310 |
| Personal Protective Equipment | Eyeshields;Faceshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| Hazard Codes | T+:Verytoxic; |
| Risk Phrases | R26/27/28;R41;R42/43 |
| Safety Phrases | S22-S26-S28-S36/37/39-S45 |
| RIDADR | UN 3462 |
| WGK Germany | 3 |
| RTECS | WK2130000 |
| Packaging Group | I |
| Hazard Class | 6.1 |
|
P7170, a novel inhibitor of mTORC1/mTORC2 and Activin receptor-like Kinase 1 (ALK1) inhibits the growth of non small cell lung cancer.
Mol. Cancer 13 , 259, (2014) Lung cancer is the major cause of cancer-related deaths and many cases of Non Small Cell Lung Cancer (NSCLC), a common type of lung cancer, have frequent genetic/oncogenic activation of EGFR, KRAS, PI... |
|
|
Combination of immortalization and inducible death strategies to generate a human mesenchymal stromal cell line with controlled survival.
Stem Cell Res. 12(2) , 584-98, (2014) The hTERT-immortalization of human bone marrow-derived Mesenchymal Stromal Cells (hMSCs) was proposed to address availability/standardization issues for experimental or clinical studies, but raised co... |
|
|
Mouse Rif1 is a key regulator of the replication-timing programme in mammalian cells.
EMBO J. 31(18) , 3678-90, (2012) The eukaryotic genome is replicated according to a specific spatio-temporal programme. However, little is known about both its molecular control and biological significance. Here, we identify mouse Ri... |
| Destomycin A |
| O-6-Amino-6-deoxy-L-glycero-D-galacto-heptopyranosylidene-(1->2- 3)-O-α-D-talopyranosyl-(1->5)-2-deoxy-N3- |
| EINECS 250-545-5 |
| D-Streptamine, O-6-amino-6-deoxy-L-glycero-D-galacto-heptopyranosylidene-(1-2-3)-O-β-D-talopyranosyl-(1-5)-2-deoxy-N3-methyl- |
| (3'R,3aS,4S,4'R,5'R,6R,6'R,7S,7aS)-4-{[(1R,2S,3R,5S,6R)-3-amino-2,6-dihydroxy-5-(methylamino)cyclohexyl]oxy}-6'-[(1S)-1-amino-2-hydroxyethyl]-6-(hydroxymethyl)octahydro-4H-spiro[1,3-dioxolo[4,5-c]pyran-2,2'-pyran]-3',4',5',7-tetrol (non-preferred name) |
| HYGROGOLD(TM) |
| hygrovetine |
| Hygromix |
| Hygromix-8 |
| antihelmycin |
| hygromix2.4 |
| Hygrovetin |
| MFCD00036846 |
| Hygromix 2.4 |
| Hygrovectine |
| Hyaromycin B |
| Hygromycin B |
| (3'R,3aS,4S,4'R,5'R,6R,6'R,7S,7aS)-4-{[(1R,2S,3R,5S,6R)-3-Amino-2,6-dihydroxy-5-(methylamino)cyclohexyl]oxy}-6'-[(1S)-1-amino-2-hydroxyethyl]-6-(hydroxymethyl)octahydro-4H-spiro[1,3-dioxolo[4,5-c]pyran-2,2'-pyran]-3',4',5',7-tetrol |
| D-Streptamine, O-6-amino-6-deoxy-L-glycero-D-galacto-heptopyranosylidene(1-2-3)-O-β-D-talopyranosyl-(1->)-2-deoxy-N3-methyl- |
| D-Streptamine, O-6-amino-6-deoxy-L-glycero-D-galacto-heptopyranosylidene-(1-2-3)-O-β-D-talopyranosyl-(1-5)-2-deoxy-N-(sup 3)-methyl- |
| hydromycinb |