(8S,9S,13S,14S)-3-hydroxy-1,13-dimethyl-9,11,12,14,15,16-hexahydro-8H-cyclopenta[a]phenanthren-17-one structure
|
Common Name | (8S,9S,13S,14S)-3-hydroxy-1,13-dimethyl-9,11,12,14,15,16-hexahydro-8H-cyclopenta[a]phenanthren-17-one | ||
|---|---|---|---|---|
| CAS Number | 3129-08-6 | Molecular Weight | 282.37700 | |
| Density | 1.168g/cm3 | Boiling Point | 467.1ºC at 760 mmHg | |
| Molecular Formula | C19H22O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 198.7ºC | |
| Name | (8S,9S,13S,14S)-3-hydroxy-1,13-dimethyl-9,11,12,14,15,16-hexahydro-8H-cyclopenta[a]phenanthren-17-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.168g/cm3 |
|---|---|
| Boiling Point | 467.1ºC at 760 mmHg |
| Molecular Formula | C19H22O2 |
| Molecular Weight | 282.37700 |
| Flash Point | 198.7ºC |
| Exact Mass | 282.16200 |
| PSA | 37.30000 |
| LogP | 4.20640 |
| Index of Refraction | 1.598 |
| InChIKey | KRCRSBUGDLOMGX-DRMAHVMPSA-N |
| SMILES | Cc1cc(O)cc2c1C1CCC3(C)C(=O)CCC3C1C=C2 |
|
~%
(8S,9S,13S,14S)... CAS#:3129-08-6 |
| Literature: Djerassi et al. Journal of the American Chemical Society, 1950 , vol. 72, p. 4534,4539 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 3-Hydroxy-1-methyl-oestra-1,3,5(10),6-tetraen-17-on |
| 1-Methyl-6-dehydro-oestron |
| 3-Hydroxy-1-methylestra-1,3,5(10),6-tetren-17-one |
| 3-hydroxy-1-methyl-estra-1,3,5(10),6-tetraen-17-one |