1,4,6-androstatrien-3,17-dione structure
|
Common Name | 1,4,6-androstatrien-3,17-dione | ||
|---|---|---|---|---|
| CAS Number | 633-35-2 | Molecular Weight | 282.377 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 452.8±45.0 °C at 760 mmHg | |
| Molecular Formula | C19H22O2 | Melting Point | 164-165ºC | |
| MSDS | Chinese USA | Flash Point | 168.7±25.7 °C | |
Use of 1,4,6-androstatrien-3,17-dioneAndrosta-1,4,6-triene-3,17-dione is a lipophilic and specific aromatase inhibitor with a Ki of 0.18 μM. Androsta-1,4,6-triene-3,17-dione inhibits estrogen biosynthesis and shows antifertility effects. Androsta-1,4,6-triene-3,17-dione induces impairment of spatial memory[1][2]. |
| Name | androsta-1,4,6-triene-3,17-dione |
|---|---|
| Synonym | More Synonyms |
| Description | Androsta-1,4,6-triene-3,17-dione is a lipophilic and specific aromatase inhibitor with a Ki of 0.18 μM. Androsta-1,4,6-triene-3,17-dione inhibits estrogen biosynthesis and shows antifertility effects. Androsta-1,4,6-triene-3,17-dione induces impairment of spatial memory[1][2]. |
|---|---|
| Related Catalog | |
| Target |
Ki: 0.18 μM (aromatase)[1] |
| In Vivo | Androsta-1,4,6-triene-3,17-dione (25-100 mg/kg; s.c.) prevents the normal rise in ovarian estradiol concentrations[2]. Androsta-1,4,6-triene-3,17-dione may act in vivo to inhibit fertility by inhibition of estrogen biosynthesis [1]. Animal Model: Rats (220-250 g)[2] Dosage: 25 mg/kg, 100 mg/kg Administration: Subcutaneous injection Result: Prevented the normal rise in ovarian estradiol concentrations with a single injection 3 hours before the time of the estrogen surge on proestrus. |
| References |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 452.8±45.0 °C at 760 mmHg |
| Melting Point | 164-165ºC |
| Molecular Formula | C19H22O2 |
| Molecular Weight | 282.377 |
| Flash Point | 168.7±25.7 °C |
| Exact Mass | 282.161987 |
| PSA | 34.14000 |
| LogP | 2.52 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.587 |
| InChIKey | DKVSUQWCZQBWCP-QAGGRKNESA-N |
| SMILES | CC12C=CC(=O)C=C1C=CC1C2CCC2(C)C(=O)CCC12 |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Safety Phrases | 22-24/25 |
|---|
|
Name: Inhibition of aromatase in human placental microsomes using [1beta-3H]AD as substrate...
Source: ChEMBL
Target: Aromatase
External Id: CHEMBL5241253
|
|
Name: Percent inhibition of human placental Cytochrome P450 19A1 at 1:1 inhibitor: androste...
Source: ChEMBL
Target: Aromatase
External Id: CHEMBL664416
|
|
Name: Percent inhibition of human placental Cytochrome P450 19A1 at 1:1 inhibitor: androste...
Source: ChEMBL
Target: Aromatase
External Id: CHEMBL657135
|
|
Name: Percent inhibition of human placental Cytochrome P450 19A1 at 3:1 inhibitor: androste...
Source: ChEMBL
Target: Aromatase
External Id: CHEMBL664417
|
|
Name: Competitive inhibition of human aromatase extracted from placental microsomes after 5...
Source: ChEMBL
Target: Aromatase
External Id: CHEMBL3755859
|
|
Name: Percent inhibition of human placental Cytochrome P450 19A1 at 3:1 inhibitor: androste...
Source: ChEMBL
Target: Aromatase
External Id: CHEMBL661748
|
| Conchinin |
| 1,4,6-androstatrien-3,17-dione |
| QUINDINE |
| Androsta-1,4,6-triene-3,17-dione |
| Chinidin |
| androst-1,4,6-triene-3,17-dione |
| Kinidin |
| Cin-quin |
| Coccinine |
| Quinidex |
| QUNIDINE |
| PITAYINE |
| Pitayin |
| 1,4,6-Androstatriene-3,17-dione |
| Androsta-1,4,6-trien-3,17-dion |