2-Methyl-3-bromo-1,4-naphthoquinone structure
|
Common Name | 2-Methyl-3-bromo-1,4-naphthoquinone | ||
|---|---|---|---|---|
| CAS Number | 3129-39-3 | Molecular Weight | 251.07600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H7BrO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-bromo-3-methyl-1,4-Naphthalenedione |
|---|
| Molecular Formula | C11H7BrO2 |
|---|---|
| Molecular Weight | 251.07600 |
| Exact Mass | 249.96300 |
| PSA | 34.14000 |
| LogP | 2.73450 |
| InChIKey | AVHXUWPFOZVLBX-UHFFFAOYSA-N |
| SMILES | CC1=C(Br)C(=O)c2ccccc2C1=O |
| HS Code | 2914700090 |
|---|
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |