Proline,1-(2,4-dinitrophenyl)-4-hydroxy-, L- (8CI) structure
|
Common Name | Proline,1-(2,4-dinitrophenyl)-4-hydroxy-, L- (8CI) | ||
|---|---|---|---|---|
| CAS Number | 3129-48-4 | Molecular Weight | 297.22100 | |
| Density | 1.68g/cm3 | Boiling Point | 591.6ºC at 760mmHg | |
| Molecular Formula | C11H11N3O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 311.6ºC | |
| Name | (2S)-1-(2,4-dinitrophenyl)-4-hydroxypyrrolidine-2-carboxylic acid |
|---|
| Density | 1.68g/cm3 |
|---|---|
| Boiling Point | 591.6ºC at 760mmHg |
| Molecular Formula | C11H11N3O7 |
| Molecular Weight | 297.22100 |
| Flash Point | 311.6ºC |
| Exact Mass | 297.06000 |
| PSA | 152.41000 |
| LogP | 1.63860 |
| Index of Refraction | 1.685 |
| InChIKey | GRVQMGMRXCLMCI-UHFFFAOYSA-N |
| SMILES | O=C(O)C1CC(O)CN1c1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
|
~%
Proline,1-(2,4-... CAS#:3129-48-4 |
| Literature: Rao; Sober Journal of the American Chemical Society, 1954 , vol. 76, p. 1328,1330 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |