Methyl 3-formyl-1H-indole-7-carboxylate structure
|
Common Name | Methyl 3-formyl-1H-indole-7-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 312973-24-3 | Molecular Weight | 203.19400 | |
| Density | 1.341 | Boiling Point | 404.4ºC at 760 mmHg | |
| Molecular Formula | C11H9NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 198.4°C | |
| Name | Methyl 3-formyl-1H-indole-7-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.341 |
|---|---|
| Boiling Point | 404.4ºC at 760 mmHg |
| Molecular Formula | C11H9NO3 |
| Molecular Weight | 203.19400 |
| Flash Point | 198.4°C |
| Exact Mass | 203.05800 |
| PSA | 59.16000 |
| LogP | 1.76700 |
| Index of Refraction | 1.677 |
| InChIKey | JVUPHJBFLSMOGY-UHFFFAOYSA-N |
| SMILES | COC(=O)c1cccc2c(C=O)c[nH]c12 |
| HS Code | 2933990090 |
|---|
|
~93%
Methyl 3-formyl... CAS#:312973-24-3 |
| Literature: Abbott GmbH and Co. KG Patent: US7049312 B1, 2006 ; Location in patent: Page/Page column 112 ; US 7049312 B1 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| IND050 |
| 3-FORMYLINDOLE-7-CARBOXYLIC ACID METHYL ESTER |
| 7-methoxycarbonyl-3-indolcarboxaldehyde |
| 7-methoxycarbonyl-3-indolecarboxaldehyde |