Arjunic acid structure
|
Common Name | Arjunic acid | ||
|---|---|---|---|---|
| CAS Number | 31298-06-3 | Molecular Weight | 488.699 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 602.7±55.0 °C at 760 mmHg | |
| Molecular Formula | C30H48O5 | Melting Point | N/A | |
| MSDS | USA | Flash Point | 332.3±28.0 °C | |
Use of Arjunic acidArjunic acid (Arjuntriterpenic acid) (compound 13) is a triterpenoid compound isolated from Sanguisorba officinalis L[1]. |
| Name | Arjunic acid |
|---|---|
| Synonym | More Synonyms |
| Description | Arjunic acid (Arjuntriterpenic acid) (compound 13) is a triterpenoid compound isolated from Sanguisorba officinalis L[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 602.7±55.0 °C at 760 mmHg |
| Molecular Formula | C30H48O5 |
| Molecular Weight | 488.699 |
| Flash Point | 332.3±28.0 °C |
| Exact Mass | 488.350189 |
| PSA | 97.99000 |
| LogP | 6.21 |
| Vapour Pressure | 0.0±3.9 mmHg at 25°C |
| Index of Refraction | 1.580 |
| InChIKey | XJMYUPJDAFKICJ-HALSDPRKSA-N |
| SMILES | CC1(C)CCC2(C(=O)O)CCC3(C)C(=CCC4C5(C)CC(O)C(O)C(C)(C)C5CCC43C)C2C1O |
| Hazard Codes | Xi |
|---|---|
| RIDADR | NONH for all modes of transport |
|
~%
Arjunic acid CAS#:31298-06-3 |
| Literature: Indian Journal of Chemistry, , vol. 8, p. 772 - 775 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| (2α,3β,19α)-2,3,19-Trihydroxyolean-12-en-28-oic acid |
| Olean-12-en-28-oic acid, 2,3,19-trihydroxy-, (2α,3β,19α)- |
| 2α,3β,19α-Trihydroxyolean-12-en-28-oic acid |