2-chloro-5-nitronicotinonitrile structure
|
Common Name | 2-chloro-5-nitronicotinonitrile | ||
|---|---|---|---|---|
| CAS Number | 31309-08-7 | Molecular Weight | 183.55200 | |
| Density | 1.57g/cm3 | Boiling Point | 312.4ºC at 760 mmHg | |
| Molecular Formula | C6H2ClN3O2 | Melting Point | 121 - 126 ℃ | |
| MSDS | N/A | Flash Point | 142.8ºC | |
| Name | 2-chloro-5-nitropyridine-3-carbonitrile |
|---|---|
| Synonym | More Synonyms |
| Density | 1.57g/cm3 |
|---|---|
| Boiling Point | 312.4ºC at 760 mmHg |
| Melting Point | 121 - 126 ℃ |
| Molecular Formula | C6H2ClN3O2 |
| Molecular Weight | 183.55200 |
| Flash Point | 142.8ºC |
| Exact Mass | 182.98400 |
| PSA | 82.50000 |
| LogP | 2.03808 |
| Index of Refraction | 1.603 |
| InChIKey | CSDMFMSXIUTEFJ-UHFFFAOYSA-N |
| SMILES | N#Cc1cc([N+](=O)[O-])cnc1Cl |
|
~%
2-chloro-5-nitr... CAS#:31309-08-7 |
| Literature: Antimicrobial Agents and Chemotherapy, , vol. 58, # 1 p. 55 - 60 |
|
~%
2-chloro-5-nitr... CAS#:31309-08-7 |
| Literature: Antimicrobial Agents and Chemotherapy, , vol. 58, # 1 p. 55 - 60 |
|
~%
2-chloro-5-nitr... CAS#:31309-08-7 |
| Literature: Antimicrobial Agents and Chemotherapy, , vol. 58, # 1 p. 55 - 60 |
|
~%
2-chloro-5-nitr... CAS#:31309-08-7 |
| Literature: Antimicrobial Agents and Chemotherapy, , vol. 58, # 1 p. 55 - 60 |
| Precursor 4 | |
|---|---|
| DownStream 5 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-Chloro-3-cyano-5-nitropyridine |
| 2-chloro-5-nitro-3-pyridinecarbonitrile |
| 2-chloro-5-nitro-nicotinonitrile |
| 2-Chlor-5-nitro-nicotinonitril |
| 2-Chloro-3-cyano-5-nitropyridine,2-Chloro-5-nitronicotinonitrile |
| 5-nitro-2-chloro-3-cyanopyridine |