4,6-dichloro-2-(methylthio)pyrimidine-5-carboxylic acid structure
|
Common Name | 4,6-dichloro-2-(methylthio)pyrimidine-5-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 313339-35-4 | Molecular Weight | 239.07900 | |
| Density | 1.716g/cm3 | Boiling Point | 384.523ºC at 760 mmHg | |
| Molecular Formula | C6H4Cl2N2O2S | Melting Point | 159-163℃ | |
| MSDS | Chinese USA | Flash Point | 186.353ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 4,6-dichloro-2-methylsulfanylpyrimidine-5-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.716g/cm3 |
|---|---|
| Boiling Point | 384.523ºC at 760 mmHg |
| Melting Point | 159-163℃ |
| Molecular Formula | C6H4Cl2N2O2S |
| Molecular Weight | 239.07900 |
| Flash Point | 186.353ºC |
| Exact Mass | 237.93700 |
| PSA | 88.38000 |
| LogP | 2.20350 |
| Index of Refraction | 1.652 |
| InChIKey | LUCAXEBLTQAMHS-UHFFFAOYSA-N |
| SMILES | CSc1nc(Cl)c(C(=O)O)c(Cl)n1 |
| Storage condition | 2-8°C |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Hazard Codes | Xi |
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2933599090 |
|
~%
4,6-dichloro-2-... CAS#:313339-35-4 |
| Literature: EP2471793 A1, ; Page/Page column 58 ; |
|
~%
4,6-dichloro-2-... CAS#:313339-35-4 |
| Literature: WO2012/97478 A1, ; |
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4,6-Dichloro-2-(methylthio)pyrimidine-5-carboxylic acid |
| 4,6-dichloropyrimidine-2-methylthio-5-carboxylic acid |