Pregn-4-ene-3,20-dione,16a-(methylthio)- (7CI,8CI) structure
|
Common Name | Pregn-4-ene-3,20-dione,16a-(methylthio)- (7CI,8CI) | ||
|---|---|---|---|---|
| CAS Number | 3136-93-4 | Molecular Weight | 360.55300 | |
| Density | 1.12g/cm3 | Boiling Point | 500.4ºC at 760mmHg | |
| Molecular Formula | C22H32O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 204.7ºC | |
| Name | 16a-(methylthio)progesterone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.12g/cm3 |
|---|---|
| Boiling Point | 500.4ºC at 760mmHg |
| Molecular Formula | C22H32O2S |
| Molecular Weight | 360.55300 |
| Flash Point | 204.7ºC |
| Exact Mass | 360.21200 |
| PSA | 59.44000 |
| LogP | 5.06500 |
| Index of Refraction | 1.561 |
| InChIKey | MTOGCFGVYHTEAT-QQYXXPEKSA-N |
| SMILES | CSC1CC2C3CCC4=CC(=O)CCC4(C)C3CCC2(C)C1C(C)=O |
|
~%
Pregn-4-ene-3,2... CAS#:3136-93-4 |
| Literature: Hoffman,A.S. et al. Journal of Medicinal and Pharmaceutical Chemistry, 1962 , vol. 5, p. 962 - 975 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Tirilazad |
| Tirilazadum |
| tirilazad of tirilazad |