Pregn-4-ene-3,20-dione,16a-(methylthio)- (7CI,8CI)
Pregn-4-ene-3,20-dione,16a-(methylthio)- (7CI,8CI) structure
|
Common Name | Pregn-4-ene-3,20-dione,16a-(methylthio)- (7CI,8CI) | ||
|---|---|---|---|---|
| CAS Number | 3136-93-4 | Molecular Weight | 360.55300 | |
| Density | 1.12g/cm3 | Boiling Point | 500.4ºC at 760mmHg | |
| Molecular Formula | C22H32O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 204.7ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 16a-(methylthio)progesterone |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.12g/cm3 |
|---|---|
| Boiling Point | 500.4ºC at 760mmHg |
| Molecular Formula | C22H32O2S |
| Molecular Weight | 360.55300 |
| Flash Point | 204.7ºC |
| Exact Mass | 360.21200 |
| PSA | 59.44000 |
| LogP | 5.06500 |
| Index of Refraction | 1.561 |
| InChIKey | MTOGCFGVYHTEAT-QQYXXPEKSA-N |
| SMILES | CSC1CC2C3CCC4=CC(=O)CCC4(C)C3CCC2(C)C1C(C)=O |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
Pregn-4-ene-3,2... CAS#:3136-93-4 |
| Literature: Hoffman,A.S. et al. Journal of Medicinal and Pharmaceutical Chemistry, 1962 , vol. 5, p. 962 - 975 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Tirilazad |
| Tirilazadum |
| tirilazad of tirilazad |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What are the upstream materials of 16a-(methylthio)progesterone? |
| A: Related upstream materials(CAS) of 16a-(methylthio)progesterone: 1096-38-4;74-93-1. |
| Q: What is the boiling point of 16a-(methylthio)progesterone? |
| A: Boiling point of 16a-(methylthio)progesterone is 500.4ºC at 760mmHg. |
| Q: What is the CAS number of 16a-(methylthio)progesterone? |
| A: CAS number of 16a-(methylthio)progesterone is 3136-93-4. |
| Q: What English synonyms does 16a-(methylthio)progesterone have? |
| A: English synonyms of 16a-(methylthio)progesterone: Tirilazad, Tirilazadum, tirilazad of tirilazad. |
| Q: What is the InChIKey of 16a-(methylthio)progesterone? |
| A: InChIKey of 16a-(methylthio)progesterone is MTOGCFGVYHTEAT-QQYXXPEKSA-N. |
| Q: What is the LogP of 16a-(methylthio)progesterone? |
| A: LogP of 16a-(methylthio)progesterone is 5.06500. |
| Q: What is the SMILES notation of 16a-(methylthio)progesterone? |
| A: SMILES notation of 16a-(methylthio)progesterone is CSC1CC2C3CCC4=CC(=O)CCC4(C)C3CCC2(C)C1C(C)=O. |
| Q: What is the English name of 16a-(methylthio)progesterone? |
| A: The English name of 16a-(methylthio)progesterone is 16a-(methylthio)progesterone. |
| Q: What is the molecular weight of 16a-(methylthio)progesterone? |
| A: Molecular weight of 16a-(methylthio)progesterone is 360.55300. |
| Q: What is the polar surface area (PSA) of 16a-(methylthio)progesterone? |
| A: Polar surface area (PSA) of 16a-(methylthio)progesterone is 59.44000. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |