benzene-1,4-disulfonic acid structure
|
Common Name | benzene-1,4-disulfonic acid | ||
|---|---|---|---|---|
| CAS Number | 31375-02-7 | Molecular Weight | 238.23800 | |
| Density | 1.764g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C6H6O6S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | benzene-1,4-disulfonic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.764g/cm3 |
|---|---|
| Molecular Formula | C6H6O6S2 |
| Molecular Weight | 238.23800 |
| Exact Mass | 237.96100 |
| PSA | 125.50000 |
| LogP | 2.34160 |
| Index of Refraction | 1.62 |
| InChIKey | OATNQHYJXLHTEW-UHFFFAOYSA-N |
| SMILES | O=S(=O)(O)c1ccc(S(=O)(=O)O)cc1 |
| HS Code | 2904100000 |
|---|
| Precursor 8 | |
|---|---|
| DownStream 3 | |
| HS Code | 2904100000 |
|---|---|
| Summary | 2904100000 derivatives containing only sulpho groups, their salts and ethyl esters。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| para-benzenedisulfonic acid |
| 1,4-Benzoldisulfonsaeure |
| p-benzenedisulfonic acid |
| p-Benzoldisulfonsaeure |
| Disulf |
| benzene-1,4-disulphonic acid |
| 1,4-Benzenedisulfonicacid |
| Benzol-1,4-disulfonsaeure |