2-Amino-6-(trifluoromethyl)benzoic acid
Modify Date: 2025-08-25 08:33:42
2-Amino-6-(trifluoromethyl)benzoic acid structure
|
Common Name | 2-Amino-6-(trifluoromethyl)benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 314-46-5 | Molecular Weight | 205.134 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 296.6±40.0 °C at 760 mmHg | |
| Molecular Formula | C8H6F3NO2 | Melting Point | >202ºC | |
| MSDS | N/A | Flash Point | 133.2±27.3 °C | |
| Name | 2-Amino-6-(trifluoromethyl)benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 296.6±40.0 °C at 760 mmHg |
| Melting Point | >202ºC |
| Molecular Formula | C8H6F3NO2 |
| Molecular Weight | 205.134 |
| Flash Point | 133.2±27.3 °C |
| Exact Mass | 205.035065 |
| PSA | 63.32000 |
| LogP | 3.06 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.528 |
| InChIKey | XZBQDBWIRHIZGJ-UHFFFAOYSA-N |
| SMILES | Nc1cccc(C(F)(F)F)c1C(=O)O |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | 22-36/37/38 |
| Safety Phrases | 26 |
| HS Code | 2922499990 |
|
~%
2-Amino-6-(trif... CAS#:314-46-5 |
| Literature: Journal of Organic Chemistry, , vol. 17, p. 149,153 |
|
~%
2-Amino-6-(trif... CAS#:314-46-5 |
| Literature: WO2007/4735 A1, ; Page/Page column 12-13 ; |
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| 2-amino-6-(trifluoromethyl)benzoicacid |
| 2-Amino-6-trifluoromethylbenzoic acid |
| 2-Amino-6-(trifluoromethyl)benzoic acid |
| MFCD01569538 |