ART-CHEM-BB B018023 structure
|
Common Name | ART-CHEM-BB B018023 | ||
|---|---|---|---|---|
| CAS Number | 31405-23-9 | Molecular Weight | 253.75100 | |
| Density | 1.33g/cm3 | Boiling Point | 345.5ºC at 760 mmHg | |
| Molecular Formula | C11H12ClN3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 162.7ºC | |
| Name | 3-[(4-chlorophenyl)methyl]-4-ethyl-1H-1,2,4-triazole-5-thione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.33g/cm3 |
|---|---|
| Boiling Point | 345.5ºC at 760 mmHg |
| Molecular Formula | C11H12ClN3S |
| Molecular Weight | 253.75100 |
| Flash Point | 162.7ºC |
| Exact Mass | 253.04400 |
| PSA | 69.51000 |
| LogP | 2.83090 |
| Index of Refraction | 1.657 |
| InChIKey | MHQJBBXIVRRAOJ-UHFFFAOYSA-N |
| SMILES | CCn1c(Cc2ccc(Cl)cc2)n[nH]c1=S |
| Hazard Codes | Xi: Irritant; |
|---|---|
| HS Code | 2933990090 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-Aethyl-5-<4-chlor-benzyl>-4H-<1,2,4>triazol-3-thiol |