L-Leucine,N-[(4-chlorophenoxy)acetyl]- (9CI) structure
|
Common Name | L-Leucine,N-[(4-chlorophenoxy)acetyl]- (9CI) | ||
|---|---|---|---|---|
| CAS Number | 31413-05-5 | Molecular Weight | 299.75000 | |
| Density | 1.237g/cm3 | Boiling Point | 523.8ºC at 760 mmHg | |
| Molecular Formula | C14H18ClNO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 270.6ºC | |
| Name | 2-[[2-(4-chlorophenoxy)acetyl]amino]-4-methylpentanoic acid |
|---|
| Density | 1.237g/cm3 |
|---|---|
| Boiling Point | 523.8ºC at 760 mmHg |
| Molecular Formula | C14H18ClNO4 |
| Molecular Weight | 299.75000 |
| Flash Point | 270.6ºC |
| Exact Mass | 299.09200 |
| PSA | 75.63000 |
| LogP | 2.72520 |
| Index of Refraction | 1.534 |
| InChIKey | WYSWPXYFHDNPOF-UHFFFAOYSA-N |
| SMILES | CC(C)CC(NC(=O)COc1ccc(Cl)cc1)C(=O)O |
|
~%
L-Leucine,N-[(4... CAS#:31413-05-5 |
| Literature: Krewson et al. Journal of Agricultural and Food Chemistry, 1956 , vol. 4, p. 140,141 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |