1,5,5-triethyl-1,3-diazinane-2,4,6-trione structure
|
Common Name | 1,5,5-triethyl-1,3-diazinane-2,4,6-trione | ||
|---|---|---|---|---|
| CAS Number | 3144-07-8 | Molecular Weight | 212.24600 | |
| Density | 1.093g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C10H16N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1,5,5-triethyl-1,3-diazinane-2,4,6-trione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.093g/cm3 |
|---|---|
| Molecular Formula | C10H16N2O3 |
| Molecular Weight | 212.24600 |
| Exact Mass | 212.11600 |
| PSA | 66.48000 |
| LogP | 1.15780 |
| Index of Refraction | 1.464 |
| InChIKey | NGTUNPVABSLDOF-UHFFFAOYSA-N |
| SMILES | CCN1C(=O)NC(=O)C(CC)(CC)C1=O |
|
~%
1,5,5-triethyl-... CAS#:3144-07-8 |
| Literature: Dox; Hjort Journal of Pharmacology and Experimental Therapeutics, vol. 31, p. 456 Chem. Zentralbl., 1928 , vol. 99, # I p. 1433 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 1,5,5-Triaethyl-barbitursaeure |
| 1,5,5-triethylpyrimidine-2,4,6(1h,3h,5h)-trione |
| 1,5,5-triethyl-pyrimidine-2,4,6-trione |
| 1,5,5-triethyl-barbituric acid |
| 1,5,5-Triethylbarbitursaeure |