Diethyl diethylmalonate structure
|
Common Name | Diethyl diethylmalonate | ||
|---|---|---|---|---|
| CAS Number | 77-25-8 | Molecular Weight | 216.274 | |
| Density | 1.0±0.1 g/cm3 | Boiling Point | 229.0±0.0 °C at 760 mmHg | |
| Molecular Formula | C11H20O4 | Melting Point | 228-230 °C (lit.) | |
| MSDS | Chinese USA | Flash Point | 94.4±0.0 °C | |
| Name | Diethyl Diethylmalonate Diethyl |
|---|---|
| Synonym | More Synonyms |
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 229.0±0.0 °C at 760 mmHg |
| Melting Point | 228-230 °C (lit.) |
| Molecular Formula | C11H20O4 |
| Molecular Weight | 216.274 |
| Flash Point | 94.4±0.0 °C |
| Exact Mass | 216.136154 |
| PSA | 52.60000 |
| LogP | 2.46 |
| Vapour Pressure | 0.1±0.4 mmHg at 25°C |
| Index of Refraction | 1.434 |
| InChIKey | ZKBBUZRGPULIRN-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(CC)(CC)C(=O)OCC |
| HS Code | 2917190090 |
|---|---|
| Summary | 2917190090 acyclic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Diethyl diethylmalonate |
| Propanedioic acid, 2,2-diethyl-, diethyl ester |
| MFCD00009132 |
| diethyl 2,2-diethylpropanedioate |
| EINECS 201-016-2 |