Maleanilic acid,2',4',5'-trichloro- (6CI,8CI) structure
|
Common Name | Maleanilic acid,2',4',5'-trichloro- (6CI,8CI) | ||
|---|---|---|---|---|
| CAS Number | 31460-72-7 | Molecular Weight | 294.51900 | |
| Density | 1.639g/cm3 | Boiling Point | 499.1ºC at 760 mmHg | |
| Molecular Formula | C10H6Cl3NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 255.6ºC | |
| Name | 4-oxo-4-(2,4,5-trichloroanilino)but-2-enoic acid |
|---|
| Density | 1.639g/cm3 |
|---|---|
| Boiling Point | 499.1ºC at 760 mmHg |
| Molecular Formula | C10H6Cl3NO3 |
| Molecular Weight | 294.51900 |
| Flash Point | 255.6ºC |
| Exact Mass | 292.94100 |
| PSA | 66.40000 |
| LogP | 3.29910 |
| Index of Refraction | 1.657 |
| InChIKey | DSSMWFQGSGULFH-OWOJBTEDSA-N |
| SMILES | O=C(O)C=CC(=O)Nc1cc(Cl)c(Cl)cc1Cl |
|
~82%
Maleanilic acid... CAS#:31460-72-7 |
| Literature: Gupta; Wagh Indian Journal of Chemistry - Section B Organic and Medicinal Chemistry, 2006 , vol. 45, # 3 p. 697 - 702 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |