4-hydroxy-2,3,4,5,6-pentamethylcyclohexa-2,5-dien-1-one structure
|
Common Name | 4-hydroxy-2,3,4,5,6-pentamethylcyclohexa-2,5-dien-1-one | ||
|---|---|---|---|---|
| CAS Number | 31464-76-3 | Molecular Weight | 180.24400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H16O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-hydroxy-2,3,4,5,6-pentamethylcyclohexa-2,5-dien-1-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H16O2 |
|---|---|
| Molecular Weight | 180.24400 |
| Exact Mass | 180.11500 |
| PSA | 37.30000 |
| LogP | 1.99290 |
| InChIKey | LABFEIRVSKZQER-UHFFFAOYSA-N |
| SMILES | CC1=C(C)C(C)(O)C(C)=C(C)C1=O |
|
~98%
4-hydroxy-2,3,4... CAS#:31464-76-3 |
| Literature: Fischer, A.; Henderson, N. Tetrahedron Letters, 1980 , vol. 21, p. 701 - 704 |
|
~%
4-hydroxy-2,3,4... CAS#:31464-76-3 |
| Literature: Suzuki,H.; Nakamura,K. Bulletin of the Chemical Society of Japan, 1971 , vol. 44, p. 227 - 231 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 2,5-Cyclohexadien-1-one,4-hydroxy-2,3,4,5,6-pentamethyl |
| 1-Hydroxy-1,2,3,5,6-pentamethylcyclohexadien-2,5-on-4 |
| Hydroxy-pentamethyl-cyclohexadienon |
| 4-Hydroxy-2,3,4,5,6-pentamethyl-cyclohexa-2,5-dienon |
| 4-hydroxy-2,3,4,5,6-pentamethyl-2,5-cyclohexadien-1-one |
| 4-hydroxy-2,3,4,5,6-pentamethylcyclohexa-2,5-dienone |
| 4-Hydroxy-2,3,4,5,6-pentamethyl-cyclohexa-2,5-dien-1-on |