DUROQUINONE structure
|
Common Name | DUROQUINONE | ||
|---|---|---|---|---|
| CAS Number | 527-17-3 | Molecular Weight | 164.20100 | |
| Density | 1.039 g/cm3 | Boiling Point | 230.1ºC at 760 mmHg | |
| Molecular Formula | C10H12O2 | Melting Point | 110-112 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 83.6ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | duroquinone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.039 g/cm3 |
|---|---|
| Boiling Point | 230.1ºC at 760 mmHg |
| Melting Point | 110-112 °C(lit.) |
| Molecular Formula | C10H12O2 |
| Molecular Weight | 164.20100 |
| Flash Point | 83.6ºC |
| Exact Mass | 164.08400 |
| PSA | 34.14000 |
| LogP | 1.81100 |
| Index of Refraction | 1.493 |
| InChIKey | WAMKWBHYPYBEJY-UHFFFAOYSA-N |
| SMILES | CC1=C(C)C(=O)C(C)=C(C)C1=O |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATAMUTATION DATA
|
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| RTECS | GU5410000 |
| HS Code | 2914690090 |
| Precursor 9 | |
|---|---|
| DownStream 10 | |
| HS Code | 2914690090 |
|---|---|
| Summary | 2914690090 other quinones。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
|
Quinone-induced protein handling changes: implications for major protein handling systems in quinone-mediated toxicity.
Toxicol. Appl. Pharmacol. 280(2) , 285-95, (2014) Para-quinones such as 1,4-Benzoquinone (BQ) and menadione (MD) and ortho-quinones including the oxidation products of catecholamines, are derived from xenobiotics as well as endogenous molecules. The ... |
|
|
Method development in quantitative NMR towards metrologically traceable organic certified reference materials used as (31)P qNMR standards.
Anal. Bioanal. Chem 407 , 3115-3123, (2015) Quantitative nuclear magnetic resonance (qNMR) spectroscopy is employed by an increasing number of analytical and industrial laboratories for the assignment of content and quantitative determination o... |
|
|
Using high-performance ¹H NMR (HP-qNMR®) for the certification of organic reference materials under accreditation guidelines--describing the overall process with focus on homogeneity and stability assessment.
J. Pharm. Biomed. Anal. 93 , 102-110, (2014) Quantitative NMR spectroscopy (qNMR) is gaining interest across both analytical and industrial research applications and has become an essential tool for the content assignment and quantitative determ... |
| Duroquinone |
| 2,3,5,6-tetramethyl-1,4-BQ |
| p-Benzoquinone,tetramethyl |
| Tetramethylquinone |
| MFCD00001604 |
| 2,3,5,6-tetramethylcyclohexa-2,5-diene-1,4-dione |
| EINECS 208-409-8 |
| 2,3,5,6-Tetramethyl-1,4-benzoquinone |
| 2,3,5,6-Tetramethyl-1,4-benzoquinone,Tetramethyl-p-benzoquinone |
| p-Benzoquinone,2,3,5,6-tetramethyl |
| Tetramethyl-p-quinone |
| 2,3,5,6-tetramethyl-p-benzoquinone |
| TetraMethyl-1,4-benzoquinone |
| tetramethylbenzoquinone |
| 2,3,5,6-Tetramethylbenzoquinone |
| Tetramethyl-p-benzoquinone |