UV Absorber UV-329 structure
|
Common Name | UV Absorber UV-329 | ||
|---|---|---|---|---|
| CAS Number | 3147-75-9 | Molecular Weight | 323.432 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 471.8±55.0 °C at 760 mmHg | |
| Molecular Formula | C20H25N3O | Melting Point | 106-108 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 239.2±31.5 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | Octrizole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 471.8±55.0 °C at 760 mmHg |
| Melting Point | 106-108 °C(lit.) |
| Molecular Formula | C20H25N3O |
| Molecular Weight | 323.432 |
| Flash Point | 239.2±31.5 °C |
| Exact Mass | 323.199768 |
| PSA | 50.94000 |
| LogP | 7.29 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
| Index of Refraction | 1.585 |
| InChIKey | IYAZLDLPUNDVAG-UHFFFAOYSA-N |
| SMILES | CC(C)(C)CC(C)(C)c1ccc(O)c(-n2nc3ccccc3n2)c1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S37/39 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 1 |
| HS Code | 2933990090 |
|
~97%
UV Absorber UV-329 CAS#:3147-75-9 |
| Literature: Tanimoto, Shigeo; Kamano, Takayoshi Synthesis, 1986 , # 8 p. 647 - 649 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| EUSORB 323 |
| 2-(2H-Benzo[d][1,2,3]triazol-2-yl)-4-(2,4,4-trimethylpentan-2-yl)phenol |
| TINUVIN 329 |
| 2-(2H-Benzotriazol-2-yl)-4-(2,4,4-trimethylpentan-2-yl)phenol |
| 2-Benzotriazol-2-yl-4-(1,1,3,3-tetramethyl-butyl)-phenol |
| 2-(2H-benzotriazol-2-yl)-4-(1,1,3,3-tetramethylbutyl)phenol |
| ThasorbUv329 |
| Cyasorb UV 5411 |
| Benzotriazole UV 329 |
| UV Absorber UV-329 |
| 2-(2-Hydroxy-5-tert-octylphenyl)benzotriazole |
| UV-329 |
| UV ABSORBERS 5411 |
| MFCD00013338 |
| EINECS 221-573-5 |
| 2-(2H-Benzotriazol-2-yl)-4-(2,4,4-trimethyl-2-pentanyl)phenol |
| UV ABSORBER 329 |