Phosphonic acid,P-phenyl-, bis(2-ethylhexyl) ester structure
|
Common Name | Phosphonic acid,P-phenyl-, bis(2-ethylhexyl) ester | ||
|---|---|---|---|---|
| CAS Number | 3151-39-1 | Molecular Weight | 382.51700 | |
| Density | 0.97g/cm3 | Boiling Point | 453.6ºC at 760mmHg | |
| Molecular Formula | C22H39O3P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 241.4ºC | |
| Name | bis(2-ethylhexoxy)phosphorylbenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 0.97g/cm3 |
|---|---|
| Boiling Point | 453.6ºC at 760mmHg |
| Molecular Formula | C22H39O3P |
| Molecular Weight | 382.51700 |
| Flash Point | 241.4ºC |
| Exact Mass | 382.26400 |
| PSA | 45.34000 |
| LogP | 6.97100 |
| Index of Refraction | 1.48 |
| InChIKey | POYAQWAYIGGXOL-UHFFFAOYSA-N |
| SMILES | CCCCC(CC)COP(=O)(OCC(CC)CCCC)c1ccccc1 |
| HS Code | 2931900090 |
|---|
|
~%
Phosphonic acid... CAS#:3151-39-1 |
| Literature: Victor Chem. Works Patent: US2400577 , 1944 ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| phenyl-phosphonic acid bis-(2-ethyl-hexyl ester) |
| bis(2-ethylhexyl) phenylphosphonate |
| Di-(2-ethylhexyl)-phenylphosphonat |
| 2-ethylhexyl phenylphosphonate |
| EINECS 221-587-1 |
| Phenylphosphonsaeure-bis-<2-aethyl-hexylester> |
| Phosphonic acid,phenyl-,bis(2-ethylhexyl) ester |