Phosphonous acid,P-phenyl-, bis(2,2,2-trifluoroethyl) ester structure
|
Common Name | Phosphonous acid,P-phenyl-, bis(2,2,2-trifluoroethyl) ester | ||
|---|---|---|---|---|
| CAS Number | 55322-67-3 | Molecular Weight | 306.14100 | |
| Density | N/A | Boiling Point | 216.9ºC at 760 mmHg | |
| Molecular Formula | C10H9F6O2P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 85ºC | |
| Name | phenyl-bis(2,2,2-trifluoroethoxy)phosphane |
|---|
| Boiling Point | 216.9ºC at 760 mmHg |
|---|---|
| Molecular Formula | C10H9F6O2P |
| Molecular Weight | 306.14100 |
| Flash Point | 85ºC |
| Exact Mass | 306.02400 |
| PSA | 32.05000 |
| LogP | 3.78160 |
| InChIKey | FFUBSEWWUZRSPB-UHFFFAOYSA-N |
| SMILES | FC(F)(F)COP(OCC(F)(F)F)c1ccccc1 |
|
~73%
Phosphonous aci... CAS#:55322-67-3 |
| Literature: Denney,D.B.; Denney,D.Z.; Hammond,P.J. Journal of the American Chemical Society, 1981 , vol. 103, p. 1785 |