3-(4-CHLOROPHENYL)-2,5-FURANDIONE
3-(4-CHLOROPHENYL)-2,5-FURANDIONE structure
|
Common Name | 3-(4-CHLOROPHENYL)-2,5-FURANDIONE | ||
|---|---|---|---|---|
| CAS Number | 3152-15-6 | Molecular Weight | 208.59800 | |
| Density | 1.488g/cm3 | Boiling Point | 367.3ºC at 760mmHg | |
| Molecular Formula | C10H5ClO3 | Melting Point | 152-154ºC | |
| MSDS | N/A | Flash Point | 169.9ºC | |
Summary: 3-(4-chlorophenyl)furan-2,5-dione (Chinese name: 3-(4-氯苯基)-2,5-呋喃二酮，CAS number: 3152-15-6) is an organic compound with molecular formula C10H5ClO3 and molecular weight 208.59800. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-(4-chlorophenyl)furan-2,5-dione |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.488g/cm3 |
|---|---|
| Boiling Point | 367.3ºC at 760mmHg |
| Melting Point | 152-154ºC |
| Molecular Formula | C10H5ClO3 |
| Molecular Weight | 208.59800 |
| Flash Point | 169.9ºC |
| Exact Mass | 207.99300 |
| PSA | 43.37000 |
| LogP | 1.80680 |
| Index of Refraction | 1.62 |
| InChIKey | BSZGHMTWYIUDFZ-UHFFFAOYSA-N |
| SMILES | O=C1C=C(c2ccc(Cl)cc2)C(=O)O1 |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| HS Code | 2917399090 |
|---|
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 7 | |
|---|---|
| DownStream 2 | |
CAS#:873-73-4
CAS#:201230-82-2
CAS#:108-31-6
CAS#:140-53-4
CAS#:17333-85-6
CAS#:3926-62-3
CAS#:624-48-6
CAS#:58755-77-4
CAS#:58755-78-5This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2917399090 |
|---|---|
| Summary | 2917399090 aromatic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 3-(4-chlorophenyl)maleic anhydride |
| 3-(4-Chlorophenyl)-2,5-furandione |
| 3-(4-chlorophenyl)-2,5-dihydrofuran-2,5-dione |
| 1-(4-Chlorphenyl)maleinsaeureanhydrid |
| chlorophenylfurandione |
| p-[Chlorophenyl]maleic anhydride |
| (4-Chlor-phenyl)-maleinsaeure-anhydrid |
| 2-(4-chlorophenyl)maleic anhydride |
| (4-chloro-phenyl)-maleic acid anhydride |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 3-(4-chlorophenyl)furan-2,5-dione? |
| A: Molecular weight of 3-(4-chlorophenyl)furan-2,5-dione is 208.59800. |
| Q: What is the SMILES notation of 3-(4-chlorophenyl)furan-2,5-dione? |
| A: SMILES notation of 3-(4-chlorophenyl)furan-2,5-dione is O=C1C=C(c2ccc(Cl)cc2)C(=O)O1. |
| Q: What is the polar surface area (PSA) of 3-(4-chlorophenyl)furan-2,5-dione? |
| A: Polar surface area (PSA) of 3-(4-chlorophenyl)furan-2,5-dione is 43.37000. |
| Q: What is the English name of 3-(4-chlorophenyl)furan-2,5-dione? |
| A: The English name of 3-(4-chlorophenyl)furan-2,5-dione is 3-(4-chlorophenyl)furan-2,5-dione. |
| Q: What is the CAS number of 3-(4-chlorophenyl)furan-2,5-dione? |
| A: CAS number of 3-(4-chlorophenyl)furan-2,5-dione is 3152-15-6. |
| Q: What is the melting point of 3-(4-chlorophenyl)furan-2,5-dione? |
| A: Melting point of 3-(4-chlorophenyl)furan-2,5-dione is 152-154ºC. |
| Q: What are the downstream products of 3-(4-chlorophenyl)furan-2,5-dione? |
| A: Related downstream products(CAS) of 3-(4-chlorophenyl)furan-2,5-dione: 58755-77-4;58755-78-5. |
| Q: What are the upstream materials of 3-(4-chlorophenyl)furan-2,5-dione? |
| A: Related upstream materials(CAS) of 3-(4-chlorophenyl)furan-2,5-dione: 873-73-4;201230-82-2;108-31-6;140-53-4;17333-85-6;3926-62-3;624-48-6. |
| Q: What is the molecular formula of 3-(4-chlorophenyl)furan-2,5-dione? |
| A: Molecular formula of 3-(4-chlorophenyl)furan-2,5-dione is C10H5ClO3. |
| Q: What is the InChIKey of 3-(4-chlorophenyl)furan-2,5-dione? |
| A: InChIKey of 3-(4-chlorophenyl)furan-2,5-dione is BSZGHMTWYIUDFZ-UHFFFAOYSA-N. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |