3-(4-CHLOROPHENYL)-2,5-FURANDIONE structure
|
Common Name | 3-(4-CHLOROPHENYL)-2,5-FURANDIONE | ||
|---|---|---|---|---|
| CAS Number | 3152-15-6 | Molecular Weight | 208.59800 | |
| Density | 1.488g/cm3 | Boiling Point | 367.3ºC at 760mmHg | |
| Molecular Formula | C10H5ClO3 | Melting Point | 152-154ºC | |
| MSDS | N/A | Flash Point | 169.9ºC | |
| Name | 3-(4-chlorophenyl)furan-2,5-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.488g/cm3 |
|---|---|
| Boiling Point | 367.3ºC at 760mmHg |
| Melting Point | 152-154ºC |
| Molecular Formula | C10H5ClO3 |
| Molecular Weight | 208.59800 |
| Flash Point | 169.9ºC |
| Exact Mass | 207.99300 |
| PSA | 43.37000 |
| LogP | 1.80680 |
| Index of Refraction | 1.62 |
| InChIKey | BSZGHMTWYIUDFZ-UHFFFAOYSA-N |
| SMILES | O=C1C=C(c2ccc(Cl)cc2)C(=O)O1 |
| HS Code | 2917399090 |
|---|
| Precursor 7 | |
|---|---|
| DownStream 2 | |
| HS Code | 2917399090 |
|---|---|
| Summary | 2917399090 aromatic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 3-(4-chlorophenyl)maleic anhydride |
| 3-(4-Chlorophenyl)-2,5-furandione |
| 3-(4-chlorophenyl)-2,5-dihydrofuran-2,5-dione |
| 1-(4-Chlorphenyl)maleinsaeureanhydrid |
| chlorophenylfurandione |
| p-[Chlorophenyl]maleic anhydride |
| (4-Chlor-phenyl)-maleinsaeure-anhydrid |
| 2-(4-chlorophenyl)maleic anhydride |
| (4-chloro-phenyl)-maleic acid anhydride |