4-Methoxy-2,3,5,6-tetrafluorobenzoic acid structure
|
Common Name | 4-Methoxy-2,3,5,6-tetrafluorobenzoic acid | ||
|---|---|---|---|---|
| CAS Number | 3153-01-3 | Molecular Weight | 224.10900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H4F4O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,3,5,6-Tetrafluoro-4-methoxybenzoic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C8H4F4O3 |
|---|---|
| Molecular Weight | 224.10900 |
| Exact Mass | 224.01000 |
| PSA | 46.53000 |
| LogP | 1.94980 |
| InChIKey | MWSDDXXQRTVVDO-UHFFFAOYSA-N |
| SMILES | COc1c(F)c(F)c(C(=O)O)c(F)c1F |
| Storage condition | 2-8°C |
| Hazard Codes | Xn |
|---|---|
| HS Code | 2918990090 |
|
~%
4-Methoxy-2,3,5... CAS#:3153-01-3 |
| Literature: IMPERIAL CHEMICAL INDUSTRIES PLC Patent: EP266947 B1, 1991 ; |
|
~%
4-Methoxy-2,3,5... CAS#:3153-01-3 |
| Literature: Birchall,J.M. et al. Journal of the Chemical Society [Section] A: Inorganic, Physical, Theoretical, 1967 , p. 747 - 753 |
|
~%
4-Methoxy-2,3,5... CAS#:3153-01-3 |
| Literature: Domagala; Bridges; Culbertson; Gambino; Hagen; Karrick; Porter; Sanchez; Sesnie; Spense; Szotek; Wemple Journal of Medicinal Chemistry, 1991 , vol. 34, # 3 p. 1142 - 1154 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 4-Methoxy-tetrafluor-benzoesaeure |
| 2,3,5,6-Tetrafluoro-4-methoxybenzoesaeure |
| 2,3,5,6-Tetrafluor-4-methoxy-benzoesaeure |
| Benzoic acid,2,3,5,6-tetrafluoro-4-methoxy |
| 4-methoxy-2,3,5,6-tetrafluorobenzoic acid |