Vanadyl acetylacetonate structure
|
Common Name | Vanadyl acetylacetonate | ||
|---|---|---|---|---|
| CAS Number | 3153-26-2 | Molecular Weight | 265.157 | |
| Density | 1,4 g/cm3 | Boiling Point | 140°C 13mm | |
| Molecular Formula | C10H14O5V | Melting Point | 235 °C (dec.)(lit.) | |
| MSDS | Chinese USA | Flash Point | 79 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | Vanadyl acetylacetonate |
|---|---|
| Synonym | More Synonyms |
| Density | 1,4 g/cm3 |
|---|---|
| Boiling Point | 140°C 13mm |
| Melting Point | 235 °C (dec.)(lit.) |
| Molecular Formula | C10H14O5V |
| Molecular Weight | 265.157 |
| Flash Point | 79 °C |
| Exact Mass | 265.028076 |
| PSA | 69.67000 |
| LogP | 1.80140 |
| InChIKey | GROXHKBCYOBDIM-FDGPNNRMSA-L |
| SMILES | CC(=O)C=C(C)[O-].CC(=O)C=C(C)[O-].[V+2] |
| Stability | Stable, but air sensitive. May discolour upon exposure to air. Incompatible with strong oxidizing agents. |
| Water Solubility | practically insoluble |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302-H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xn:Harmful; |
| Risk Phrases | R20/21/22;R36/37/38 |
| Safety Phrases | 22-26-36-36/37/39 |
| RIDADR | 3285 |
| WGK Germany | 3 |
| Packaging Group | III |
| Hazard Class | 6.1 |
| HS Code | 29420000 |
|
~%
Vanadyl acetyla... CAS#:3153-26-2 |
| Literature: Polyhedron, , vol. 69, p. 1 - 9 |
|
~46%
Vanadyl acetyla... CAS#:3153-26-2 |
| Literature: Long; Lagowski Synthesis and Reactivity in Inorganic, Metal-Organic and Nano-Metal Chemistry, 2007 , vol. 37, # 10 p. 813 - 815 |
|
~%
Vanadyl acetyla... CAS#:3153-26-2 |
| Literature: Journal of the Chemical Society, , vol. 103, p. 78 - 90 |
| Precursor 4 | |
|---|---|
| DownStream 10 | |
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| Bis[(3Z)-4-(hydroxy-κO)-3-penten-2-onato](oxo)vanadium |
| Acetylacetone Vanadium(IV)oxy Salt |
| VANADYL PENTANEDIONATE |
| VANANDEYLACETYLACETONATE |
| VANADYL ACETYLACETONE |
| vanadium(IV)oxyacetylacetonate |
| Vanadyl acetylaceton |
| EINECS 221-590-8 |
| Vanadyl Acetylacetonate |
| Vanadium oxyacetoacetonate |
| oxobis(2,4-pentanedionato)vanadium(IV) |
| Bis[(3Z)-4-(hydroxy-κO)pent-3-en-2-onato](oxo)vanadium |
| VO(acac)2 (Vanadium(IV)-oxy acetylacetonate |
| VANADIUMOXY ACETYLACETONATE |
| Vanadium, bis[(3Z)-4-(hydroxy-κO)-3-penten-2-onato]oxo- |
| VO(acac)2 |
| bis(acetylacetonate)oxovanadium |
| Vanadyl(IV) acetylacetonate |
| Vanadium(IV)-oxy acetylacetonate |
| vanadium di(acetylacetonate) |
| V(IV)-oxyacetylacetonate |
| Vanadylacetylacetonate |
| Bis(2,4-pentanedionato)vanadium(IV) Oxide |
| Vanadium(IV)oxy Acetylacetonate |
| VANADYL 2,4-PENTANEDIONATE |
| MFCD00000032 |
| bis(acetylacetonato)oxovanadium |
| Vanadium(IV)oxy Acetyla |