4-(4-Methoxyphenyl)-4-oxobutanoic acid structure
|
Common Name | 4-(4-Methoxyphenyl)-4-oxobutanoic acid | ||
|---|---|---|---|---|
| CAS Number | 3153-44-4 | Molecular Weight | 208.211 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 419.5±25.0 °C at 760 mmHg | |
| Molecular Formula | C11H12O4 | Melting Point | 148-150 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 167.5±16.7 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 4-(4-methoxyphenyl)-4-oxobutanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 419.5±25.0 °C at 760 mmHg |
| Melting Point | 148-150 °C(lit.) |
| Molecular Formula | C11H12O4 |
| Molecular Weight | 208.211 |
| Flash Point | 167.5±16.7 °C |
| Exact Mass | 208.073563 |
| PSA | 63.60000 |
| LogP | 1.36 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.536 |
| InChIKey | OMTDIBZSUZNVJK-UHFFFAOYSA-N |
| SMILES | COc1ccc(C(=O)CCC(=O)O)cc1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi:Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2918990090 |
| Precursor 9 | |
|---|---|
| DownStream 9 | |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 3-(4-METHOXYBENZOYL)propanoic acid |
| 4-(4-Methoxyphenyl)-4-oxobutyric Acid |
| 4-p-methoxyphenyl-4-oxobutyric acid |
| 3-(4-Methoxybenzoyl)-propionic acid |
| EINECS 221-593-4 |
| 3-(4-Methoxybenzoyl)Propionic Acid |
| 4-Oxo-4-(4-methoxyphenyl)butanoic acid |
| Benzenebutanoic acid, 4-methoxy-γ-oxo- |
| 4-(4-Methoxyphenyl)-4-oxobutanoic acid |
| 3-(p-methoxybenzoyl)-propionic acid |
| MFCD00002795 |