3-(2-hydroxyethyl)-7H-purine-2,6-dione structure
|
Common Name | 3-(2-hydroxyethyl)-7H-purine-2,6-dione | ||
|---|---|---|---|---|
| CAS Number | 31542-69-5 | Molecular Weight | 196.16300 | |
| Density | 1.595g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C7H8N4O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-(2-hydroxyethyl)-7H-purine-2,6-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.595g/cm3 |
|---|---|
| Molecular Formula | C7H8N4O3 |
| Molecular Weight | 196.16300 |
| Exact Mass | 196.06000 |
| PSA | 104.03000 |
| Index of Refraction | 1.641 |
| InChIKey | KSBIHRUISZUCSJ-UHFFFAOYSA-N |
| SMILES | O=c1[nH]c(=O)n(CCO)c2nc[nH]c12 |
| HS Code | 2933990090 |
|---|
|
~%
3-(2-hydroxyeth... CAS#:31542-69-5 |
| Literature: Searle and Co. Patent: US2517410 , 1947 ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| KSBIHRUISZUCSJ-UHFFFAOYSA |
| 3-hydroxyethylxanthine |