3-(2-hydroxyethyl)-1,7-dimethyl-purine-2,6-dione
Modify Date: 2025-10-30 06:58:56
3-(2-hydroxyethyl)-1,7-dimethyl-purine-2,6-dione structure
|
Common Name | 3-(2-hydroxyethyl)-1,7-dimethyl-purine-2,6-dione | ||
|---|---|---|---|---|
| CAS Number | 7501-74-8 | Molecular Weight | 224.21700 | |
| Density | 1.51g/cm3 | Boiling Point | 502.1ºC at 760 mmHg | |
| Molecular Formula | C9H12N4O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 257.5ºC | |
| Name | 3-(2-hydroxyethyl)-1,7-dimethylpurine-2,6-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.51g/cm3 |
|---|---|
| Boiling Point | 502.1ºC at 760 mmHg |
| Molecular Formula | C9H12N4O3 |
| Molecular Weight | 224.21700 |
| Flash Point | 257.5ºC |
| Exact Mass | 224.09100 |
| PSA | 82.05000 |
| Index of Refraction | 1.683 |
| InChIKey | IXMHBGPZAMEMMF-UHFFFAOYSA-N |
| SMILES | Cn1c(=O)c2c(ncn2C)n(CCO)c1=O |
|
~%
3-(2-hydroxyeth... CAS#:7501-74-8 |
| Literature: Blicke; Godt Journal of the American Chemical Society, 1954 , vol. 76, p. 3653 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 1,7-dimethyl-3-(2-hydroxyethyl) xanthine |
| 3-(2-hydroxy-ethyl)-1,7-dimethyl-3,7-dihydro-purine-2,6-dione |
| 3-(2-Hydroxy-aethyl)-1,7-dimethyl-3,7-dihydro-purin-2,6-dion |