1-(2-Chlorophenyl)-2-nitroethylene structure
|
Common Name | 1-(2-Chlorophenyl)-2-nitroethylene | ||
|---|---|---|---|---|
| CAS Number | 3156-34-1 | Molecular Weight | 183.59200 | |
| Density | 1.324 g/cm3 | Boiling Point | 295.3ºC at 760 mmHg | |
| Molecular Formula | C8H6ClNO2 | Melting Point | 45-49 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | >230 °F | |
| Symbol |
GHS07, GHS09 |
Signal Word | Warning | |
| Name | 1-chloro-2-[(E)-2-nitroethenyl]benzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.324 g/cm3 |
|---|---|
| Boiling Point | 295.3ºC at 760 mmHg |
| Melting Point | 45-49 °C(lit.) |
| Molecular Formula | C8H6ClNO2 |
| Molecular Weight | 183.59200 |
| Flash Point | >230 °F |
| Exact Mass | 183.00900 |
| PSA | 45.82000 |
| LogP | 3.11060 |
| Index of Refraction | 1.615 |
| InChIKey | QHKJTRDWAZGBLR-AATRIKPKSA-N |
| SMILES | O=[N+]([O-])C=Cc1ccccc1Cl |
| Symbol |
GHS07, GHS09 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302-H319-H400 |
| Precautionary Statements | P273-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Faceshields;Gloves |
| Hazard Codes | Xn:Harmful;N:Dangerousfortheenvironment; |
| Risk Phrases | R22;R50 |
| Safety Phrases | S36/37-S60-S61 |
| RIDADR | UN 3077 9/PG 3 |
| WGK Germany | 2 |
| Hazard Class | 9.0 |
| HS Code | 2904909090 |
| HS Code | 2904909090 |
|---|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 2-chloronitrostyrene |
| 1-chloro-2-(2-nitrovinyl)benzene |
| MFCD00024820 |