N-Cbz-3-aminomethylpiperidine structure
|
Common Name | N-Cbz-3-aminomethylpiperidine | ||
|---|---|---|---|---|
| CAS Number | 315717-76-1 | Molecular Weight | 248.321 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 385.7±25.0 °C at 760 mmHg | |
| Molecular Formula | C14H20N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 187.1±23.2 °C | |
| Name | benzyl 3-(aminomethyl)piperidine-1-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 385.7±25.0 °C at 760 mmHg |
| Molecular Formula | C14H20N2O2 |
| Molecular Weight | 248.321 |
| Flash Point | 187.1±23.2 °C |
| Exact Mass | 248.152481 |
| PSA | 55.56000 |
| LogP | 1.51 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.550 |
| InChIKey | PAIJQGYSIGOWOF-UHFFFAOYSA-N |
| SMILES | NCC1CCCN(C(=O)OCc2ccccc2)C1 |
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3-Aminomethyl-1-N-Cbz-piperidine |
| 3-aminomethylpiperidin-1-ylcarboxylic acid benzyl ester |
| MFCD03001691 |
| 1-Piperidinecarboxylic acid, 3-(aminomethyl)-, phenylmethyl ester |
| N-Cbz-3-aminomethylpiperidine |
| Benzyl 3-(aminomethyl)-1-piperidinecarboxylate |
| 1-Benzyloxycarbonyl-3-aminomethylpiperidine |
| benzyl 3-(aminomethyl)piperidine-1-carboxylate |