Benzene,4-[(4-chlorophenoxy)methyl]-1,2-dimethoxy- structure
|
Common Name | Benzene,4-[(4-chlorophenoxy)methyl]-1,2-dimethoxy- | ||
|---|---|---|---|---|
| CAS Number | 31574-17-1 | Molecular Weight | 278.73100 | |
| Density | 1.19g/cm3 | Boiling Point | 386.6ºC at 760 mmHg | |
| Molecular Formula | C15H15ClO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 138.7ºC | |
| Name | 4-[(4-chlorophenoxy)methyl]-1,2-dimethoxybenzene |
|---|
| Density | 1.19g/cm3 |
|---|---|
| Boiling Point | 386.6ºC at 760 mmHg |
| Molecular Formula | C15H15ClO3 |
| Molecular Weight | 278.73100 |
| Flash Point | 138.7ºC |
| Exact Mass | 278.07100 |
| PSA | 27.69000 |
| LogP | 3.93620 |
| Index of Refraction | 1.559 |
| InChIKey | BYBNWFSDDAHGPG-UHFFFAOYSA-N |
| SMILES | COc1ccc(COc2ccc(Cl)cc2)cc1OC |
|
~%
Benzene,4-[(4-c... CAS#:31574-17-1 |
| Literature: Prokipcak,J.M.; Breckles,T.H. Canadian Journal of Chemistry, 1971 , vol. 49, p. 914 - 918 |
|
~%
Benzene,4-[(4-c... CAS#:31574-17-1 |
| Literature: Prokipcak,J.M.; Breckles,T.H. Canadian Journal of Chemistry, 1971 , vol. 49, p. 914 - 918 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |