Benzene,1,2-dimethoxy-4-[(4-nitrophenoxy)methyl]- structure
|
Common Name | Benzene,1,2-dimethoxy-4-[(4-nitrophenoxy)methyl]- | ||
|---|---|---|---|---|
| CAS Number | 31574-19-3 | Molecular Weight | 289.28300 | |
| Density | 1.236g/cm3 | Boiling Point | 444.5ºC at 760mmHg | |
| Molecular Formula | C15H15NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 190.3ºC | |
| Name | 1,2-dimethoxy-4-[(4-nitrophenoxy)methyl]benzene |
|---|
| Density | 1.236g/cm3 |
|---|---|
| Boiling Point | 444.5ºC at 760mmHg |
| Molecular Formula | C15H15NO5 |
| Molecular Weight | 289.28300 |
| Flash Point | 190.3ºC |
| Exact Mass | 289.09500 |
| PSA | 73.51000 |
| LogP | 3.71420 |
| Index of Refraction | 1.575 |
| InChIKey | TZZGDWVGOQYSGM-UHFFFAOYSA-N |
| SMILES | COc1ccc(COc2ccc([N+](=O)[O-])cc2)cc1OC |
|
~%
Benzene,1,2-dim... CAS#:31574-19-3 |
| Literature: Prokipcak,J.M.; Breckles,T.H. Canadian Journal of Chemistry, 1971 , vol. 49, p. 914 - 918 |
|
~%
Benzene,1,2-dim... CAS#:31574-19-3 |
| Literature: Prokipcak,J.M.; Breckles,T.H. Canadian Journal of Chemistry, 1971 , vol. 49, p. 914 - 918 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |