4-Hydroxy-2-butynyl (3-chlorophenyl)carbamate
4-Hydroxy-2-butynyl (3-chlorophenyl)carbamate structure
|
Common Name | 4-Hydroxy-2-butynyl (3-chlorophenyl)carbamate | ||
|---|---|---|---|---|
| CAS Number | 3159-28-2 | Molecular Weight | 239.65500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H10ClNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-Hydroxy-2-butynyl (3-chlorophenyl)carbamate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H10ClNO3 |
|---|---|
| Molecular Weight | 239.65500 |
| Exact Mass | 239.03500 |
| PSA | 62.05000 |
| LogP | 1.89780 |
| InChIKey | ACYQQFWLJXHFND-UHFFFAOYSA-N |
| SMILES | O=C(Nc1cccc(Cl)c1)OCC#CCO |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| HS Code | 2924299090 |
|---|
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 2 | |
CAS#:3159-29-3
CAS#:101-27-9This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 4-Hydroxy-2-butynyl (3-chlorophenyl)carbamate? |
| A: Molecular weight of 4-Hydroxy-2-butynyl (3-chlorophenyl)carbamate is 239.65500. |
| Q: What is the Chinese name of 3159-28-2? |
| A: Chinese name of 3159-28-2 is 3159-28-2. |
| Q: What is the English name of 4-Hydroxy-2-butynyl (3-chlorophenyl)carbamate? |
| A: The English name of 4-Hydroxy-2-butynyl (3-chlorophenyl)carbamate is 4-Hydroxy-2-butynyl (3-chlorophenyl)carbamate. |
| Q: What is the CAS number of 4-Hydroxy-2-butynyl (3-chlorophenyl)carbamate? |
| A: CAS number of 4-Hydroxy-2-butynyl (3-chlorophenyl)carbamate is 3159-28-2. |
| Q: What are the downstream products of 4-Hydroxy-2-butynyl (3-chlorophenyl)carbamate? |
| A: Related downstream products(CAS) of 4-Hydroxy-2-butynyl (3-chlorophenyl)carbamate: 3159-29-3;101-27-9. |
| Q: What is the LogP of 4-Hydroxy-2-butynyl (3-chlorophenyl)carbamate? |
| A: LogP of 4-Hydroxy-2-butynyl (3-chlorophenyl)carbamate is 1.89780. |
| Q: What is the polar surface area (PSA) of 4-Hydroxy-2-butynyl (3-chlorophenyl)carbamate? |
| A: Polar surface area (PSA) of 4-Hydroxy-2-butynyl (3-chlorophenyl)carbamate is 62.05000. |
| Q: What is the molecular formula of 4-Hydroxy-2-butynyl (3-chlorophenyl)carbamate? |
| A: Molecular formula of 4-Hydroxy-2-butynyl (3-chlorophenyl)carbamate is C11H10ClNO3. |
| Q: What is the SMILES notation of 4-Hydroxy-2-butynyl (3-chlorophenyl)carbamate? |
| A: SMILES notation of 4-Hydroxy-2-butynyl (3-chlorophenyl)carbamate is O=C(Nc1cccc(Cl)c1)OCC#CCO. |
| Q: What is the InChIKey of 4-Hydroxy-2-butynyl (3-chlorophenyl)carbamate? |
| A: InChIKey of 4-Hydroxy-2-butynyl (3-chlorophenyl)carbamate is ACYQQFWLJXHFND-UHFFFAOYSA-N. |