Barban structure
|
Common Name | Barban | ||
|---|---|---|---|---|
| CAS Number | 101-27-9 | Molecular Weight | 258.101 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 340.8±32.0 °C at 760 mmHg | |
| Molecular Formula | C11H9Cl2NO2 | Melting Point | 75-76ºC | |
| MSDS | Chinese USA | Flash Point | 159.9±25.1 °C | |
| Symbol |
GHS07, GHS09 |
Signal Word | Warning | |
Use of BarbanBarban is a selective herbicide for wild oats. |
| Name | barban |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 340.8±32.0 °C at 760 mmHg |
| Melting Point | 75-76ºC |
| Molecular Formula | C11H9Cl2NO2 |
| Molecular Weight | 258.101 |
| Flash Point | 159.9±25.1 °C |
| Exact Mass | 257.001038 |
| PSA | 38.33000 |
| LogP | 3.87 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.607 |
| InChIKey | MCOQHIWZJUDQIC-UHFFFAOYSA-N |
| SMILES | O=C(Nc1cccc(Cl)c1)OCC#CCCl |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
MUTATION DATA
|
| Symbol |
GHS07, GHS09 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302-H317-H410 |
| Precautionary Statements | P273-P280-P501 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Faceshields;Gloves |
| Hazard Codes | Xn: Harmful;N: Dangerous for the environment; |
| Risk Phrases | R22 |
| Safety Phrases | 24-36/37-60-61 |
| RIDADR | UN3077 9/PG 3 |
| RTECS | FD7700000 |
| HS Code | 2924299013 |
|
~%
Barban CAS#:101-27-9 |
| Literature: Journal of Organic Chemistry, , vol. 24, p. 2040 |
|
~%
Barban CAS#:101-27-9 |
| Literature: Agricultural and Biological Chemistry, , vol. 44, # 6 p. 1237 - 1240 |
|
~%
Barban CAS#:101-27-9 |
| Literature: J. Gen. Chem. USSR (Engl. Transl.), , vol. 33, p. 46 - 49,41 - 43 |
| HS Code | 2924299013 |
|---|---|
| Summary | 2924299013. VAT:17.0%. Tax rebate rate:9.0%. Supervision conditions:S(import or export registration certificate for pesticides). MFN tariff:6.5%. General tariff:30.0% |
|
Synthesis of polyynes to model the sp-carbon allotrope carbyne.
Nature Chemistry 2(11) , 967-71, (2010) Carbyne is an allotrope of carbon composed of sp-hybridized carbon atoms. Although its formation in the laboratory is suggested, no well-defined sample is described. Interest in carbyne and its potent... |
|
|
Calcium-decorated carbyne networks as hydrogen storage media.
Nano Lett. 11(7) , 2660-5, (2011) Among the carbon allotropes, carbyne chains appear outstandingly accessible for sorption and very light. Hydrogen adsorption on calcium-decorated carbyne chain was studied using ab initio density func... |
|
|
The pressure tunning Raman and IR spectral studies on the multinuclear metal carbyne complexes.
Spectrochim. Acta. A. Mol. Biomol. Spectrosc. 61(5) , 995-1000, (2005) The Raman and infrared (IR) spectra of four tungsten metal carbyne complexes I, II, IV and V [Cl(CO)2(L)W[triple bond]CC6H4[triple bond](C[triple bond]CC6H4)n[triple bond]N[triple bond]C[triple bond]]... |
| Carbamic acid, N-(3-chlorophenyl)-, 4-chloro-2-butyn-1-yl ester |
| 4-Chlorobut-2-yn-1-yl (3-chlorophenyl)carbamate |
| Chlorinat |
| EINECS 202-930-4 |
| MFCD00045297 |
| 4-Chloro-2-butyn-1-yl (3-chlorophenyl)carbamate |
| 4-chlorobut-2-ynyl N-(3-chlorophenyl)carbamate |
| N-(m-chlorophenyl)carbamic acid,4-chloro-2-butynyl ester |
| Karbin |
| 4-chlorobut-2-ynyl 3-chlorocarbanilate |
| Carbine |
| 4-chloro-2-butynyl 3-chlorocarbanilate |
| Barban |
| 4-chloro-2-butynyl N-(m-chlorophenyl)carbamate |
| Carbin |
| Barbanate |
| 4-Chlorobut-2-ynyl 3-chlorophenylcarbamate |
| Barbamate |
| Chlorinate |
| 4-chloro-2-butynyl m-chlorocarbanilate |
| 4-chloro-2-butyn-1-yl N-(3-chlorophenyl)carbamate |
| Barbane |
| Carbyne (herbicide) |
| Carbyne |