2-(chloromethyl)-3-methyl-1,4-Naphthalenedione structure
|
Common Name | 2-(chloromethyl)-3-methyl-1,4-Naphthalenedione | ||
|---|---|---|---|---|
| CAS Number | 31599-79-8 | Molecular Weight | 220.65200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H9ClO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(chloromethyl)-3-methyl-1,4-Naphthalenedione |
|---|
| Molecular Formula | C12H9ClO2 |
|---|---|
| Molecular Weight | 220.65200 |
| Exact Mass | 220.02900 |
| PSA | 34.14000 |
| LogP | 2.62090 |
| InChIKey | PYQUHGSCPCDFBQ-UHFFFAOYSA-N |
| SMILES | CC1=C(CCl)C(=O)c2ccccc2C1=O |
| Precursor 0 | |
|---|---|
| DownStream 2 | |
|
Name: MAO Inhibition Assay from Article 10.1111/cbdd.12708: "Evaluation of Natural and Synt...
Source: BindingDB
Target: N/A
External Id: BindingDB_7153_1
|