Ethyl 4-chloro-5,8-dimethylquinoline-3-carboxylate structure
|
Common Name | Ethyl 4-chloro-5,8-dimethylquinoline-3-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 338954-51-1 | Molecular Weight | 263.71900 | |
| Density | 1.222g/cm3 | Boiling Point | 362.5ºC at 760 mmHg | |
| Molecular Formula | C14H14ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 173ºC | |
| Name | Ethyl 4-chloro-5,8-dimethylquinoline-3-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.222g/cm3 |
|---|---|
| Boiling Point | 362.5ºC at 760 mmHg |
| Molecular Formula | C14H14ClNO2 |
| Molecular Weight | 263.71900 |
| Flash Point | 173ºC |
| Exact Mass | 263.07100 |
| PSA | 39.19000 |
| LogP | 3.68170 |
| Index of Refraction | 1.593 |
| InChIKey | AFUFWMAIOJISRR-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1cnc2c(C)ccc(C)c2c1Cl |
| HS Code | 2933499090 |
|---|
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| MFCD00173361 |
| 4-Chloro-5,8-Dimethylquinoline-3-Carboxylic Ethyl Ester |