9H-Thioxanthen-9-one,10,10-dioxide structure
|
Common Name | 9H-Thioxanthen-9-one,10,10-dioxide | ||
|---|---|---|---|---|
| CAS Number | 3166-15-2 | Molecular Weight | 244.26600 | |
| Density | 1.444g/cm3 | Boiling Point | 467.2ºC at 760mmHg | |
| Molecular Formula | C13H8O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 311.8ºC | |
| Name | 10,10-dioxothioxanthen-9-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.444g/cm3 |
|---|---|
| Boiling Point | 467.2ºC at 760mmHg |
| Molecular Formula | C13H8O3S |
| Molecular Weight | 244.26600 |
| Flash Point | 311.8ºC |
| Exact Mass | 244.01900 |
| PSA | 59.59000 |
| LogP | 3.14460 |
| Index of Refraction | 1.667 |
| InChIKey | DRIRMYPZOAOUPR-UHFFFAOYSA-N |
| SMILES | O=C1c2ccccc2S(=O)(=O)c2ccccc21 |
| HS Code | 2932999099 |
|---|
| Precursor 8 | |
|---|---|
| DownStream 3 | |
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 9-oxo-9H-thioxanthene-10,10-dioxide |
| 9-thioxanthone 10,10-dioxide |
| thioxanthen-9-one-10,10-dioxide |
| 9H-thioxanthen-9-one 10,10-dioxide |
| Thioxanthone S,S-dioxide |
| thioxanthen-9-one-S,S-dioxide |
| thioxanten-9-one 10,10-dioxide |