Thioxanthen-9-ol, 9-phenol-, 10,10-dioxide structure
|
Common Name | Thioxanthen-9-ol, 9-phenol-, 10,10-dioxide | ||
|---|---|---|---|---|
| CAS Number | 6630-81-5 | Molecular Weight | 322.37800 | |
| Density | 1.388g/cm3 | Boiling Point | 541.5ºC at 760 mmHg | |
| Molecular Formula | C19H14O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 281.3ºC | |
| Name | 10,10-dioxo-9-phenylthioxanthen-9-ol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.388g/cm3 |
|---|---|
| Boiling Point | 541.5ºC at 760 mmHg |
| Molecular Formula | C19H14O3S |
| Molecular Weight | 322.37800 |
| Flash Point | 281.3ºC |
| Exact Mass | 322.06600 |
| PSA | 62.75000 |
| LogP | 4.19780 |
| Index of Refraction | 1.693 |
| InChIKey | LBVZDBOJWNAZQS-UHFFFAOYSA-N |
| SMILES | O=S1(=O)c2ccccc2C(O)(c2ccccc2)c2ccccc21 |
|
~72%
Thioxanthen-9-o... CAS#:6630-81-5 |
| Literature: Taljaard, Benjamin; Goosen, Andre; McCleland, Cedric W. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1989 , p. 931 - 934 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| 9-Phenyl-9H-thioxanthen-9-ol 10,10-dioxide |
| HMS3079J08 |
| 9-phenylthioxanthen-9-ol 10,10-dioxide |
| 9-Hydroxy-9-phenylsulfonylxanthen |