N-[cyano(methylsulfanyl)methyl]-4-methoxybenzamide structure
|
Common Name | N-[cyano(methylsulfanyl)methyl]-4-methoxybenzamide | ||
|---|---|---|---|---|
| CAS Number | 31666-18-9 | Molecular Weight | 236.29000 | |
| Density | 1.214g/cm3 | Boiling Point | 421.3ºC at 760mmHg | |
| Molecular Formula | C11H12N2O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 208.6ºC | |
| Name | N-[cyano(methylsulfanyl)methyl]-4-methoxybenzamide |
|---|
| Density | 1.214g/cm3 |
|---|---|
| Boiling Point | 421.3ºC at 760mmHg |
| Molecular Formula | C11H12N2O2S |
| Molecular Weight | 236.29000 |
| Flash Point | 208.6ºC |
| Exact Mass | 236.06200 |
| PSA | 87.42000 |
| LogP | 2.02858 |
| Index of Refraction | 1.568 |
| InChIKey | ILYIOFPQHLMOBX-UHFFFAOYSA-N |
| SMILES | COc1ccc(C(=O)NC(C#N)SC)cc1 |
|
~%
N-[cyano(methyl... CAS#:31666-18-9 |
| Literature: Shah; Lam; Ketcham Journal of medicinal chemistry, 1971 , vol. 14, # 5 p. 456 - 458 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |