4-Methyl-3-nitrobenzaldehyde structure
|
Common Name | 4-Methyl-3-nitrobenzaldehyde | ||
|---|---|---|---|---|
| CAS Number | 31680-07-6 | Molecular Weight | 165.146 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 276.3±28.0 °C at 760 mmHg | |
| Molecular Formula | C8H7NO3 | Melting Point | 46-49 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 130.1±16.8 °C | |
| Name | 4-methyl-3-nitrobenzaldehyde |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 276.3±28.0 °C at 760 mmHg |
| Melting Point | 46-49 °C(lit.) |
| Molecular Formula | C8H7NO3 |
| Molecular Weight | 165.146 |
| Flash Point | 130.1±16.8 °C |
| Exact Mass | 165.042587 |
| PSA | 62.89000 |
| LogP | 2.21 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.603 |
| InChIKey | KHWGAWBXQOKXIJ-UHFFFAOYSA-N |
| SMILES | Cc1ccc(C=O)cc1[N+](=O)[O-] |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Hazard Codes | Xi: Irritant;Xn: Harmful; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36/37/39-S37/39 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2913000090 |
| HS Code | 2913000090 |
|---|---|
| Summary | HS: 2913000090 halogenated, sulphonated, nitrated or nitrosated derivatives of products of heading 2912 Educational tariff:17.0% Tax rebate rate:9.0% Regulatory conditions:none Most favored nation tariff:5.5% General tariff:30.0% |
|
4-Methyl-3-nitrobenzaldehyde. Guo ZR, et al.
Acta Crystallogr. B Struct. Sci. Cryst. Eng. Mater. 66(9) , o2420-o2420., (2010)
|
|
|
Study of vibrational spectra of 4-methyl-3-nitrobenzaldehyde. Yadav BS, et al.
Indian J. Pure Appl. Phys. 44(9) , 644, (2006)
|
|
|
The chemistry of indoles. XXXII A facile synthetic method for 6-indolecarbaldehyde, 6-indolemethanol, and 6-substituted 1-hydroxyindoles and its application for the synthesis of a natural alkaloid,(E)-6-(3-methylbuta-1, 3-dienyl) indole. Somei M.
Chem. Pharm. Bull. 34(10) , 4109-4115, (1986)
|
| MFCD00017011 |
| 4-Methyl-3-nitrobenzaldehyde |
| EINECS 250-760-4 |
| 3-Nitro-p-tolualdehyde |
| 4-Methyl-3-nitro-benzaldehyd |
| WNR B1 EVH |
| 3-Nitro-p-toluylaldehyd |
| Benzaldehyde, 4-methyl-3-nitro- |
| 3-nitro-4-tolualdehyde |
| methylnitrobenzaldehyde |
| 4-methyl-3-nitro-benzaldehyde |
| 3-nitro-4-methyl benzaldehyde |